CymitQuimica logo

CAS 685108-10-5

:

2-[3-(2,5-Dimethyl-1H-pyrrol-1-yl)-2-thienyl]-6-(2-pyridinyl)pyrazolo[1,5-a]pyrimidin-7-amine

Description:
The chemical substance known as 2-[3-(2,5-Dimethyl-1H-pyrrol-1-yl)-2-thienyl]-6-(2-pyridinyl)pyrazolo[1,5-a]pyrimidin-7-amine, with the CAS number 685108-10-5, is a complex organic compound characterized by its multi-ring structure, which includes a pyrazolo[1,5-a]pyrimidine core. This compound features various functional groups, including an amine and heterocycles such as pyrrole, thienyl, and pyridine, contributing to its potential biological activity. The presence of multiple methyl groups and nitrogen-containing rings suggests that it may exhibit interesting pharmacological properties, possibly acting as a kinase inhibitor or having other therapeutic applications. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, due to the diverse functional groups present. Overall, this compound represents a class of heterocyclic compounds that are of interest in medicinal chemistry for their potential roles in drug development.
Formula:C21H18N6S
InChI:InChI=1S/C21H18N6S/c1-13-6-7-14(2)26(13)18-8-10-28-20(18)17-11-19-24-12-15(21(22)27(19)25-17)16-5-3-4-9-23-16/h3-12H,22H2,1-2H3
InChI key:InChIKey=NEAUHOSITQKCEK-UHFFFAOYSA-N
SMILES:CC=1N(C2=C(SC=C2)C3=NN4C(=C3)N=CC(=C4N)C5=CC=CC=N5)C(C)=CC1
Synonyms:
  • Pyrazolo[1,5-a]pyrimidin-7-amine, 2-[3-(2,5-dimethyl-1H-pyrrol-1-yl)-2-thienyl]-6-(2-pyridinyl)-
  • 2-[3-(2,5-Dimethyl-1H-pyrrol-1-yl)-2-thienyl]-6-(2-pyridinyl)pyrazolo[1,5-a]pyrimidin-7-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.