CAS 68512-16-3
:Decane, brominated chlorinated
Description:
Decane, brominated chlorinated (CAS 68512-16-3) is a synthetic organic compound characterized by the presence of both bromine and chlorine atoms attached to a decane backbone, which consists of a straight-chain alkane with ten carbon atoms. This compound typically exhibits properties associated with halogenated hydrocarbons, such as increased density and potential for lower volatility compared to its non-halogenated counterparts. The presence of bromine and chlorine can enhance its reactivity and stability under certain conditions, making it useful in various applications, including as a flame retardant or in chemical synthesis. However, the halogenation also raises environmental and health concerns, as such compounds can be persistent in the environment and may pose risks to aquatic life and human health. Proper handling and disposal are essential to mitigate these risks. Overall, Decane, brominated chlorinated is a complex chemical with specific applications and implications that require careful consideration in both industrial and environmental contexts.
Formula:Unspecified
InChI:InChI=1/C10H17Br3Cl2/c1-7(11)3-2-4-10(15)9(13)5-8(12)6-14/h7-10H,2-6H2,1H3
Synonyms:- Decane, brominated chlorinated
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Decane, brominated chlorinated
CAS:<p>Decane, brominated chlorinated is a biochemical.</p>Formula:C10H17Br3Cl2Color and Shape:SolidMolecular weight:447.86
