CAS 68515-50-4: 1,2-Benzenedicarboxylic acid, 1,2-dihexyl ester, branched and linear
Description:1,2-Benzenedicarboxylic acid, 1,2-dihexyl ester, branched and linear, commonly known as dihexyl phthalate, is an organic compound characterized by its ester functional groups derived from phthalic acid and hexanol. This substance typically appears as a colorless to pale yellow liquid with a characteristic odor. It is known for its low volatility and relatively high boiling point, making it suitable for various applications, particularly as a plasticizer in the production of flexible plastics. The branched and linear hexyl chains contribute to its hydrophobic nature, enhancing its compatibility with non-polar solvents and polymers. Additionally, it exhibits moderate solubility in organic solvents while being poorly soluble in water. The compound is also recognized for its potential environmental and health impacts, leading to regulatory scrutiny in certain applications. Overall, 1,2-Benzenedicarboxylic acid, 1,2-dihexyl ester, is valued for its functional properties in industrial applications, although its use may be subject to restrictions due to safety considerations.
Formula:Unspecified
InChI:InChI=1/C20H30O4/c1-15(2)9-7-13-23-19(21)17-11-5-6-12-18(17)20(22)24-14-8-10-16(3)4/h5-6,11-12,15-16H,7-10,13-14H2,1-4H3
- Synonyms:
- 1,2-Benzenedicarboxylic acid, 1,2-dihexyl ester, branched and linear
- Bis(4-Methylpentyl) Benzene-1,2-Dicarboxylate
- Branched and linear dihexyl phthalate
- 1,2-Benzenedicarboxylic acid, dihexyl ester, branched and linear
