CymitQuimica logo

CAS 6852-94-4

:

pent-4-enamide

Description:
Pent-4-enamide, with the CAS number 6852-94-4, is an organic compound characterized by its amide functional group and a pentene backbone featuring a double bond at the fourth carbon position. This structure imparts unique properties, including the potential for reactivity typical of both alkenes and amides. Pent-4-enamide is likely to exhibit moderate polarity due to the presence of the amide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. The double bond in the pentene portion may allow for additional reactivity, such as polymerization or addition reactions. The compound's physical properties, such as boiling point and melting point, would be influenced by its molecular weight and the presence of functional groups. Additionally, pent-4-enamide may have applications in organic synthesis, serving as an intermediate in the production of more complex molecules or as a building block in various chemical reactions. Safety and handling considerations should be taken into account, as with any chemical substance, to ensure proper laboratory practices.
Formula:C5H9NO
InChI:InChI=1/C5H9NO/c1-2-3-4-5(6)7/h2H,1,3-4H2,(H2,6,7)
SMILES:C=CCCC(=N)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.