CAS 68521-88-0
:L-alpha-aspartyl-N~5~-(diaminomethylidene)-L-ornithyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanine acetate (1:1)
Description:
L-alpha-aspartyl-N~5~-(diaminomethylidene)-L-ornithyl-L-valyl-L-tyrosyl-L-isoleucyl-L-histidyl-L-prolyl-L-phenylalanine acetate is a complex peptide compound characterized by its specific sequence of amino acids, which includes aspartic acid, ornithine, valine, tyrosine, isoleucine, histidine, proline, and phenylalanine. This compound features a diaminomethylidene group, which contributes to its unique properties and potential biological activities. The acetate component indicates that the compound is in its acetate salt form, which can influence its solubility and stability. Peptides like this one are often studied for their roles in biological systems, including their potential therapeutic applications in areas such as neurobiology and pharmacology. The presence of multiple amino acids suggests that it may exhibit diverse interactions with biological receptors or enzymes. Overall, this compound represents a significant area of interest in peptide chemistry and biochemistry, with implications for drug design and development.
Formula:C52H75N13O14
InChI:InChI=1/C50H71N13O12.C2H4O2/c1-5-28(4)41(47(72)59-36(23-31-25-54-26-56-31)48(73)63-20-10-14-38(63)45(70)60-37(49(74)75)22-29-11-7-6-8-12-29)62-44(69)35(21-30-15-17-32(64)18-16-30)58-46(71)40(27(2)3)61-43(68)34(13-9-19-55-50(52)53)57-42(67)33(51)24-39(65)66;1-2(3)4/h6-8,11-12,15-18,25-28,33-38,40-41,64H,5,9-10,13-14,19-24,51H2,1-4H3,(H,54,56)(H,57,67)(H,58,71)(H,59,72)(H,60,70)(H,61,68)(H,62,69)(H,65,66)(H,74,75)(H4,52,53,55);1H3,(H,3,4)/t28-,33-,34-,35-,36-,37-,38-,40-,41-;/m0./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Angiotensin II human acetate
CAS:Angiotensin II human acetate (DRVYIHPF acetate) is a vasoconstrictor that mainly acts on the AT1 receptor.Formula:C52H75N13O14Purity:98.89% - 99.78%Color and Shape:SolidMolecular weight:1106.2Angiotensin II human
CAS:Custom research peptide; min purity 95%.Formula:C50H71N13O12Purity:Min. 95%Molecular weight:1,046.19 g/molAngiotensin II acetate salt
CAS:Controlled ProductAngiotensin II is a hormone that is produced in the kidneys and acts on the blood vessels, heart, and other tissues. It is also known as angiotensin II acetate salt H-Asp-Arg-Val-Tyr-Ile-His-Pro-Phe-OH acetate salt. Angiotensin II can increase blood pressure by constricting blood vessels and causing the release of aldosterone from the adrenal glands. This hormone also causes smooth muscle contraction in various organs, including the intestines. The synthesis of angiotensin II occurs through two different pathways: one involving renin and another involving prorenin. The renin pathway begins with renin converting angiotensinogen into angiotensin I, which is then converted to angiotensin II by angiotensins I converting enzyme (ACE). Angiotensin II has been shown to increase protein phosphorylation in myosin, leading to increasedFormula:C50H71N13O12·xC2H4O2Purity:Min. 95%Color and Shape:White SolidMolecular weight:1,046.18 g/mol



