CAS 68524-21-0

(5R)-5-methyl-5-[4-(3-methylbutoxy)phenyl]imidazolidine-2,4-dione

Description:

(5R)-5-methyl-5-[4-(3-methylbutoxy)phenyl]imidazolidine-2,4-dione, with the CAS number 68524-21-0, is a chemical compound characterized by its imidazolidine core structure, which features a dione functional group. This compound exhibits chirality, indicated by the (5R) designation, suggesting that it has a specific three-dimensional arrangement that can influence its biological activity and interactions. The presence of the 4-(3-methylbutoxy)phenyl group contributes to its hydrophobic characteristics, potentially affecting its solubility and reactivity in various solvents. The methyl groups in the structure may enhance its lipophilicity, which can influence its pharmacokinetic properties if it is used in medicinal chemistry. Additionally, the imidazolidine ring is known for its potential applications in pharmaceuticals, particularly in the development of drugs that target specific biological pathways. Overall, this compound's unique structural features may confer specific properties that are of interest in both research and industrial applications.

Formula: C₁₅H₂₀N₂O₃

InChI: InChI=1/C15H20N2O3/c1-10(2)8-9-20-12-6-4-11(5-7-12)15(3)13(18)16-14(19)17-15/h4-7,10H,8-9H2,1-3H3,(H2,16,17,18,19)/t15-/m1/s1

SMILES: CC(C)CCOc1ccc(cc1)[C@]1(C)C(=NC(=N1)O)O

5-Methyl-5-[4-(3-methylbutoxy)phenyl]imidazolidine-2,4-dione

CAS: 68524-21-0

Versatile small molecule scaffold

Formula: C₁₅H₂₀N₂O₃

Purity: Min. 95%

Molecular weight: 276.33 g/mol

Ref: 3D-TCA52421