CAS 68527-66-2

6-Chloro-8-nitroquinoline

Description:

6-Chloro-8-nitroquinoline is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a chlorine atom at the 6-position and a nitro group at the 8-position contributes to its unique reactivity and properties. This compound typically appears as a yellow to orange solid and is known for its potential applications in medicinal chemistry, particularly in the development of antimicrobial and antitumor agents. The nitro group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, the chlorine substituent can influence the compound's lipophilicity and biological activity. As with many nitro-containing compounds, 6-Chloro-8-nitroquinoline may exhibit specific toxicological profiles, necessitating careful handling and assessment in laboratory settings. Its solubility characteristics can vary depending on the solvent, which is an important consideration for its use in various chemical applications.

Formula: C₉H₅ClN₂O₂

InChI: InChI=1S/C9H5ClN2O2/c10-7-4-6-2-1-3-11-9(6)8(5-7)12(13)14/h1-5H

InChI key: InChIKey=LLXHVCBOOWNXPV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C2=C(C=C(Cl)C1)C=CC=N2

Synonyms:

• Quinoline, 6-Chloro-8-Nitro-
• 6-Chloro-8-nitroquinoline

6-chloro-8-nitroquinoline

CAS: 68527-66-2

Formula: C₉H₅ClN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 208.6012

Ref: IN-DA003N67

6-Chloro-8-Nitroquinoline

CAS: 68527-66-2

6-Chloro-8-Nitroquinoline

Purity: 97%

Molecular weight: 208.60g/mol

Ref: 54-OR1012009

6-CHLORO-8-NITROQUINOLINE

CAS: 68527-66-2

Purity: 98%

Molecular weight: 208.6000061

Ref: 10-F812070

6-chloro-8-nitroquinoline

CAS: 68527-66-2

6-Chloro-8-nitroquinoline is an indian nitro compound that yields a greenish yellow liquid when reacted with quinaldine, which is an aromatic amino compound. The 8-nitroquinoline group in this compound has an amino group and reacts with the fungitoxicant guanidine. This class of compounds is used to control fungi such as Aspergillus and Myrothecium verrucaria. 6-Chloro-8-nitroquinoline can be hydrolyzed by strong acids or bases, yielding chloro formates.

Formula: C₉H₅ClN₂O₂

Purity: Min. 95%

Molecular weight: 208.6 g/mol

Ref: 3D-TCA52766