CAS 6853-22-1
:α-Ethyl-α-phenyl-1-piperidinepropanol
Description:
α-Ethyl-α-phenyl-1-piperidinepropanol, with the CAS number 6853-22-1, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is characterized by the presence of an ethyl group and a phenyl group attached to the alpha carbon of the piperidine. This compound is typically a white to off-white solid and is known for its potential psychoactive properties, often investigated in the context of pharmacology and medicinal chemistry. Its molecular structure suggests it may exhibit interactions with neurotransmitter systems, although specific biological activities can vary. The compound's solubility, stability, and reactivity are influenced by its functional groups and overall molecular architecture. As with many piperidine derivatives, it may have applications in the development of pharmaceuticals or as a research chemical, but safety and handling precautions are essential due to potential toxicity or regulatory considerations.
Formula:C16H25NO
InChI:InChI=1S/C16H25NO/c1-2-16(18,15-9-5-3-6-10-15)11-14-17-12-7-4-8-13-17/h3,5-6,9-10,18H,2,4,7-8,11-14H2,1H3
InChI key:InChIKey=ZLFRZTFZUNLLDJ-UHFFFAOYSA-N
SMILES:C(CCN1CCCCC1)(CC)(O)C2=CC=CC=C2
Synonyms:- 3-Phenyl-1-piperidin-1-yl-pentan-3-ol
- 3-Phenyl-1-piperidin-1-ylpentan-3-ol
- 3-Phenyl-1-(piperidin-1-yl)pentan-3-ol
- α-Ethyl-α-phenyl-1-piperidinepropanol
- 1-Piperidinepropanol, α-ethyl-α-phenyl-
- 3-phenyl-1-(1-piperidinyl)-3-pentanol
- Trihexyphenidyl impurity 9
- Benzhexol Impurity 9
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
