
CAS 6853-58-3
:1-(Bromomethyl)-4-pentylbenzene
Description:
1-(Bromomethyl)-4-pentylbenzene, with the CAS number 6853-58-3, is an organic compound characterized by a bromomethyl group attached to a benzene ring that also features a pentyl substituent. This compound belongs to the class of alkyl-substituted aromatic compounds, which are known for their hydrophobic properties due to the presence of long hydrocarbon chains. The bromomethyl group introduces a reactive site, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The pentyl group contributes to the compound's overall hydrophobicity and can influence its solubility in organic solvents. Additionally, the presence of the bromine atom can impart unique reactivity and physical properties, such as increased density and potential for halogenation reactions. Overall, 1-(Bromomethyl)-4-pentylbenzene is of interest in synthetic organic chemistry and materials science, particularly in the development of functionalized polymers and intermediates for further chemical transformations.
Formula:C12H17Br
InChI:InChI=1S/C12H17Br/c1-2-3-4-5-11-6-8-12(10-13)9-7-11/h6-9H,2-5,10H2,1H3
InChI key:InChIKey=KQYYGIARMUPJIJ-UHFFFAOYSA-N
SMILES:C(CCCC)C1=CC=C(CBr)C=C1
Synonyms:- Benzene, 1-(bromomethyl)-4-pentyl-
- p-Pentylbenzyl bromide
- 1-(Bromomethyl)-4-pentylbenzene
- Toluene, α-bromo-p-pentyl-
- 1-(Bromomethyl)-4-n-pentylbenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.