CAS 6854-07-5

2-HYDROXY-5-NITRONICOTINIC ACID

Description:

2-Hydroxy-5-nitronicotinic acid, identified by its CAS number 6854-07-5, is a derivative of nicotinic acid, characterized by the presence of both a hydroxyl group and a nitro group on the pyridine ring. This compound typically exhibits properties associated with both carboxylic acids and aromatic nitro compounds, including potential acidity due to the carboxylic acid functional group and reactivity due to the nitro group. It is likely to be a solid at room temperature and may be soluble in polar solvents, such as water and alcohols, depending on the specific conditions. The presence of the hydroxyl group can contribute to hydrogen bonding, influencing its solubility and reactivity. This compound may have applications in pharmaceuticals, agrochemicals, or as a chemical intermediate, although specific uses would depend on its biological activity and stability. As with many nitro compounds, it may also pose certain safety and handling considerations due to potential toxicity or reactivity.

Formula: C₆H₄N₂O₅

InChI: InChI=1/C6H4N2O5/c9-5-4(6(10)11)1-3(2-7-5)8(12)13/h1-2H,(H,7,9)(H,10,11)/p-1

SMILES: c1c(cnc(c1C(=O)O)[O-])N(=O)=O

Synonyms:

• 2-Hydroxy-5-Nitropyridine-3-Carboxylic Acid
• 5-Nitro-2-Oxo-1,2-Dihydropyridine-3-Carboxylic Acid
• 5-Nitro-2-Oxo-1,2-Dihydropyridine-3-Carboxylate

2-Hydroxy-5-nitronicotinic acid

CAS: 6854-07-5

Formula: C₆H₄N₂O₅

Purity: 96%

Color and Shape: Solid

Molecular weight: 184.1064

Ref: IN-DA003MWU

2-Hydroxy-5-nitronicotinic acid

CAS: 6854-07-5

2-Hydroxy-5-nitronicotinic acid

Formula: C₆H₄N₂O₅

Purity: 96%

Color and Shape: yellow crystalline needles

Molecular weight: 184.11g/mol

Ref: 54-OR5764

2-Hydroxy-5-nitronicotinic acid

CAS: 6854-07-5

Formula: C₆H₄N₂O₅

Purity: 96%

Color and Shape: Solid

Molecular weight: 184.107

Ref: 10-F035759