CAS 68550-94-7
:Ethanol, 2-(2-ethoxyethoxy)-, phosphate
Description:
Ethanol, 2-(2-ethoxyethoxy)-, phosphate, with the CAS number 68550-94-7, is a chemical compound that belongs to the class of phosphates. It is characterized by the presence of a phosphate group attached to an ethyl alcohol derivative, which contributes to its solubility in polar solvents. This compound typically exhibits properties such as being a colorless to pale yellow liquid with a moderate viscosity. It is often used as a surfactant or emulsifying agent in various industrial applications, including cosmetics, pharmaceuticals, and agrochemicals. The presence of ethoxy groups enhances its hydrophilicity, making it effective in formulations that require good wetting and dispersing properties. Additionally, it may have applications in biochemical research due to its ability to interact with biological membranes. Safety data should be consulted for handling and exposure guidelines, as phosphates can have varying degrees of toxicity and environmental impact. Overall, this compound is valued for its functional properties in diverse chemical formulations.
Formula:C6H14O3·xH3O4P
InChI:InChI=1S/C6H14O3.H3O4P/c1-2-8-5-6-9-4-3-7;1-5(2,3)4/h7H,2-6H2,1H3;(H3,1,2,3,4)
InChI key:InChIKey=HMBVPMIZFHGVLF-UHFFFAOYSA-N
SMILES:P(=O)(O)(O)O.C(COCC)OCCO
Synonyms:- Ethanol, 2-(2-ethoxyethoxy)-, phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
