CAS 685503-45-1: 3-(3-fluoroanilino)propanoic acid

Description:3-(3-Fluoroanilino)propanoic acid is an organic compound characterized by its structure, which includes a propanoic acid moiety attached to a 3-fluoroaniline group. This compound features a fluorine atom substituted on the aromatic ring, which can influence its chemical reactivity and physical properties, such as solubility and boiling point. The presence of the aniline group suggests potential for hydrogen bonding, which may enhance its solubility in polar solvents. As a carboxylic acid, it exhibits acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The fluorine substitution can also affect the compound's electronic properties, potentially enhancing its biological activity or interaction with other molecules. This compound may be of interest in pharmaceutical research or material science due to its unique structural features. However, specific applications and safety data should be consulted from reliable sources for practical use.

Formula:C₉H₁₀FNO₂

InChI:InChI=1/C9H10FNO2/c10-7-2-1-3-8(6-7)11-5-4-9(12)13/h1-3,6,11H,4-5H2,(H,12,13)