CAS 685513-89-7

(4,5-difluoropyrrolo[2,3-b]pyridin-1-yl)-triisopropyl-silane

Description:

(4,5-Difluoropyrrolo[2,3-b]pyridin-1-yl)-triisopropyl-silane is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-b]pyridine core substituted with fluorine atoms at the 4 and 5 positions, and a triisopropylsilyl group. This compound is notable for its potential applications in medicinal chemistry and materials science, particularly due to the presence of the fluorinated heterocyclic moiety, which can enhance biological activity and lipophilicity. The triisopropylsilyl group contributes to the compound's stability and solubility in organic solvents, making it useful in various synthetic applications. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can influence reactivity and interaction with biological targets. As with many organosilicon compounds, it may exhibit interesting properties such as thermal stability and hydrophobicity. Safety and handling considerations should be taken into account, as with any chemical substance, particularly in terms of potential toxicity and environmental impact.

Formula: C₁₆H₂₄F₂N₂Si

InChI: InChI=1/C16H24F2N2Si/c1-10(2)21(11(3)4,12(5)6)20-8-7-13-15(18)14(17)9-19-16(13)20/h7-12H,1-6H3

SMILES: CC(C)[Si](C(C)C)(C(C)C)n1ccc2c(c(cnc12)F)F

Synonyms:

• 4,5-Difluor-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin
• 4,5-difluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine

1H-Pyrrolo[2,3-b]pyridine, 4,5-difluoro-1-[tris(1-methylethyl)silyl]-

CAS: 685513-89-7

Formula: C₁₆H₂₄F₂N₂Si

Purity: 98%

Color and Shape: Solid

Molecular weight: 310.4575

Ref: IN-DA005PFR

4,5-Difluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 685513-89-7

4,5-Difluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine

Purity: 98%

Molecular weight: 310.46g/mol

Ref: 54-PC1005303

4,5-Difluoro-1-(triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 685513-89-7

Purity: 98%

Molecular weight: 310.4639893

Ref: 10-F787848