CAS 685517-67-3

2,6-difluoro-3-iodopyridine

Description:

2,6-Difluoro-3-iodopyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with two fluorine atoms at the 2 and 6 positions and an iodine atom at the 3 position. This compound typically exhibits a pale yellow to light brown appearance and is known for its potential applications in medicinal chemistry and material science due to the presence of halogen substituents, which can influence its reactivity and biological activity. The fluorine atoms contribute to the compound's lipophilicity and stability, while the iodine atom can serve as a site for further chemical modifications. 2,6-Difluoro-3-iodopyridine is soluble in organic solvents and may exhibit moderate to low solubility in water. Its molecular structure allows for various interactions, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled, and proper storage conditions should be maintained to ensure stability.

Formula: C₅H₂F₂IN

InChI: InChI=1/C5H2F2IN/c6-4-2-1-3(8)5(7)9-4/h1-2H

SMILES: c1cc(F)nc(c1I)F

Synonyms:

• Pyridine, 2,6-Difluoro-3-Iodo-

2,6-Difluoro-3-iodopyridine

CAS: 685517-67-3

Formula: C₅H₂F₂IN

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.9774

Ref: IN-DA005PFP

2,6-Difluoro-3-iodopyridine

CAS: 685517-67-3

2,6-Difluoro-3-iodopyridine

Formula: C₅H₂F₂IN

Purity: 97%

Color and Shape: white crystalline powder

Molecular weight: 240.98g/mol

Ref: 54-PC7983

2,6-Difluoro-3-iodopyridine

CAS: 685517-67-3

Formula: C₅H₂F₂IN

Purity: >98.0%(GC)

Color and Shape: White to Light yellow powder to lump

Molecular weight: 240.98

Ref: 3B-D5141

2,6-Difluoro-3-iodopyridine

CAS: 685517-67-3

Formula: C₅H₂F₂IN

Purity: 95%

Color and Shape: Solid, Low Melting Solid

Molecular weight: 240.979

Ref: 10-F043662