CAS 685542-51-2

6-[3-(4-chlorophenyl)-5-methylisoxazol-4-yl]pyrimidine-2(1H)-thione

Description:

6-[3-(4-Chlorophenyl)-5-methylisoxazol-4-yl]pyrimidine-2(1H)-thione, with the CAS number 685542-51-2, is a chemical compound characterized by its unique structural features, including a pyrimidine ring and an isoxazole moiety. This compound typically exhibits properties associated with thiones, such as potential reactivity due to the presence of the sulfur atom in the thione functional group. The chlorophenyl and methyl substituents contribute to its lipophilicity and may influence its biological activity. The compound may be of interest in medicinal chemistry, particularly for its potential pharmacological applications, as derivatives of pyrimidines and isoxazoles are often explored for their therapeutic properties. Additionally, the presence of halogen atoms, like chlorine, can enhance the compound's biological activity or alter its pharmacokinetic profile. Overall, this compound's unique structure suggests it may possess interesting chemical and biological properties, warranting further investigation in research and development contexts.

Formula: C₁₄H₁₀ClN₃OS

InChI: InChI=1/C14H10ClN3OS/c1-8-12(11-6-7-16-14(20)17-11)13(18-19-8)9-2-4-10(15)5-3-9/h2-7H,1H3,(H,16,17,20)

Synonyms:

• 4-[3-(4-chlorophenyl)-5-methyl-4-isoxazolyl]-2-pyrimidinethiol

4-[3-(4-Chlorophenyl)-5-methyl-4-isoxazolyl]-2-pyrimidinethiol, 90%

CAS: 685542-51-2

4-[3-(4-Chlorophenyl)-5-methyl-4-isoxazolyl]-2-pyrimidinethiol, 90%

Purity: ≥95%

Molecular weight: 303.77g/mol

Ref: 54-OR72480