CAS 685551-55-7

5-[(2-hydroxyphenyl)amino]-6-methyl-1,2,4-triazin-3(2H)-one

Description:

5-[(2-Hydroxyphenyl)amino]-6-methyl-1,2,4-triazin-3(2H)-one, with the CAS number 685551-55-7, is a chemical compound characterized by its triazine core, which features a methyl group and a hydroxyl-substituted phenylamino group. This structure contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. The compound is likely to exhibit properties typical of triazine derivatives, such as potential antimicrobial or herbicidal activity, although specific biological effects would depend on further empirical studies. Additionally, the compound's stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety considerations should be taken into account when handling this substance, including potential toxicity and environmental impact. Overall, this compound represents a class of chemicals that may have significant applications in medicinal chemistry and agrochemicals.

Formula: C₁₀H₁₀N₄O₂

InChI: InChI=1/C10H10N4O2/c1-6-9(12-10(16)14-13-6)11-7-4-2-3-5-8(7)15/h2-5,15H,1H3,(H2,11,12,14,16)

SMILES: Cc1c(Nc2ccccc2O)nc(nn1)O

Synonyms:

• 5-[(2-Hydroxyphenyl)amino]-6-methyl-1,2,4-triazin-3(2H)-one
• 5-[(2-hydroxyphenyl)amino]-6-methyl-2,3-dihydro-1,2,4-triazin-3-one
• CHEMBRDG-BB 9070797
• 5-((2-Hydroxyphenyl)amino)-6-methyl-1,2,4-triazin-3-ol
• 5-[(2-hydroxyphenyl)amino]-6-methyl-1,2,4-triazin-3(2H)-one(SALTDATA: FREE)

5-[(2-hydroxyphenyl)amino]-6-methyl-1,2,4-triazin-3(2H)-one

CAS: 685551-55-7

Formula: C₁₀H₁₀N₄O₂

Purity: 95.0%

Molecular weight: 218.216

Ref: 10-F315947