CAS 6856-01-5
:2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, (3aR,4R,6E,10E,11aR)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-
Description:
The chemical substance known as 2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, with the specified stereochemistry and structure, is a complex organic compound characterized by its unique functional groups and stereochemical configuration. It features a butenoic acid moiety, indicating the presence of a carboxylic acid group, along with hydroxyl groups that contribute to its reactivity and potential for hydrogen bonding. The compound also contains a cyclodecafuran structure, which is a fused ring system that can influence its physical and chemical properties, such as solubility and stability. The presence of multiple chiral centers suggests that the compound can exist in various stereoisomeric forms, which may exhibit different biological activities or reactivities. Additionally, the ester functional group indicates that it can undergo hydrolysis or transesterification reactions. Overall, this compound's intricate structure and functional groups make it of interest in fields such as organic synthesis, medicinal chemistry, and materials science, where its properties can be exploited for various applications.
Formula:C20H26O6
InChI:InChI=1/C20H26O6/c1-12-5-4-6-13(2)10-17(26-20(24)15(11-22)7-8-21)18-14(3)19(23)25-16(18)9-12/h6-7,9,16-18,21-22H,3-5,8,10-11H2,1-2H3/b12-9+,13-6+,15-7+/t16-,17-,18+/m1/s1
InChI key:InChIKey=VWJYWGYJIDQUEG-DKDOXNMLSA-N
SMILES:O(C(/C(=C/CO)/CO)=O)[C@H]1[C@@]2([C@](OC(=O)C2=C)(/C=C(\C)/CC/C=C(\C)/C1)[H])[H]
Synonyms:- 2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, (3aR,4R,6E,10E,11aR)-2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-
- 2-Butenoic acid, 4-hydroxy-2-(hydroxymethyl)-, 2,3,3a,4,5,8,9,11a-octahydro-6,10-dimethyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, [3aR-[3aR*,4R*(E),6E,10E,11aR*]]-
- Crotonic acid, 4-hydroxy-2-(hydroxymethyl)-, 6-ester with 6,8-dihydroxygermacra-3,9,11(13)-trien-12-oic acid 12,8-lactone
- Cyclodeca[b]furan, 2-butenoic acid deriv.
- Eupatoriopicrin
- Eupatoriopicrine
- Germacra-1(10),4,11(13)-trien-12-oic acid, 6β,8α-dihydroxy-, 12,6-lactone, 4-hydroxy-2-(hydroxymethyl)crotonate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Eupatoriopicrin
CAS:Eupatoriopicrin: Anti-trypanosomal, cytotoxic to T. brucei rhodesiense, can damage DNA, weakly sensitizes guinea pigs.Formula:C20H26O6Purity:98%Color and Shape:SolidMolecular weight:362.422Eupatoriopicrin
CAS:Eupatoriopicrin is a sesquiterpene lactone, which is an intricate class of naturally occurring organic compounds. It is derived from plants, particularly in the Asteraceae family, such as those belonging to the Eupatorium genus. Eupatoriopicrin exhibits its mode of action primarily through the alkylation of biological nucleophiles, which can disrupt normal cellular processes. This mechanism makes it a compound of interest for its potential as an inhibitor of various biological pathways, particularly those involved in inflammation and cancer.
Formula:C20H26O6Purity:Min. 95%Molecular weight:362.4 g/mol


