CAS 6857-35-8
:1,3-Dihydro-4-(4-nitrophenyl)-2H-imidazole-2-thione
Description:
1,3-Dihydro-4-(4-nitrophenyl)-2H-imidazole-2-thione, with CAS number 6857-35-8, is a heterocyclic compound characterized by its imidazole ring structure, which contains both sulfur and nitrogen atoms. This compound features a nitrophenyl substituent at the 4-position of the imidazole ring, contributing to its potential reactivity and biological activity. The presence of the thione functional group (–C=S) indicates that it can participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Typically, compounds of this nature exhibit properties such as moderate solubility in organic solvents and potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The nitro group may enhance the compound's electron-withdrawing characteristics, influencing its reactivity and interactions with biological targets. Overall, 1,3-Dihydro-4-(4-nitrophenyl)-2H-imidazole-2-thione is of interest in both synthetic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C9H7N3O2S
InChI:InChI=1S/C9H7N3O2S/c13-12(14)7-3-1-6(2-4-7)8-5-10-9(15)11-8/h1-5H,(H2,10,11,15)
InChI key:InChIKey=VTJUTVFOBSHNSS-UHFFFAOYSA-N
SMILES:S=C1NC(C2=CC=C(N(=O)=O)C=C2)=CN1
Synonyms:- 1,3-Dihydro-4-(4-nitrophenyl)-2H-imidazole-2-thione
- 1-(4-nitrophenyl)-1,3-dihydro-2H-imidazole-2-thione
- 2H-Imidazole-2-thione, 1,3-dihydro-4-(4-nitrophenyl)-
- 4-(p-Nitrophenyl)imidazole
- Imidazole-2-thiol, 4(or 5)-(p-nitrophenyl)-
- Imidazole-2-thiol, 4-(p-nitrophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
1-(4-Nitrophenyl)imidazoline-2-thione
CAS:Formula:C9H7N3O2SColor and Shape:SolidMolecular weight:221.23581-(4-Nitrophenyl)imidazoline-2-thione
CAS:1-(4-Nitrophenyl)imidazoline-2-thione
Molecular weight:221.23578g/mol1-(4-Nitrophenyl)imidazoline-2-thione
CAS:Formula:C9H7N3O2SColor and Shape:SolidMolecular weight:221.23



