CAS 68572-87-2
:Phenanthreneboronic acid
Description:
Phenanthreneboronic acid, with the CAS number 68572-87-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenanthrene moiety. This compound typically exhibits a crystalline solid form and is known for its role in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are essential for forming carbon-carbon bonds. Phenanthreneboronic acid is soluble in polar organic solvents, and its reactivity is influenced by the boron atom, which can form reversible complexes with various nucleophiles. The presence of the phenanthrene structure contributes to its photophysical properties, making it of interest in materials science and organic electronics. Additionally, boronic acids like phenanthreneboronic acid can participate in various chemical transformations, including the formation of boronate esters and their use in sensor applications due to their ability to interact with diols. Overall, this compound is valuable in both synthetic chemistry and potential applications in advanced materials.
Formula:C14H11BO2
InChI:InChI=1/C14H11BO2/c16-15(17)14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-9,16-17H
SMILES:c1ccc2c(c1)cc(c1ccccc21)B(O)O
Synonyms:- 9-Phenanthreneboronic acid (contains varying amounts of anhydride)
- Phenanthrene-9-boronic acid
- 9-Phenanthracenylboronic acid
- Phenanthren-9-Ylboronic Acid
- 9-Phenanthrenylboronic Acid
- 9-Phenanthreneboronic Acid
- 9-Phenanthrene boronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
9-Phenanthreneboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C14H11BO2Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:222.05Phenanthrene-9-boronic acid, 97%
CAS:Phenanthrene-9-boronic acid as a reactant is involved in the synthesis of large polycyclic aromatic hydrocarbons (PAHs) and electron rich benzo[g,h,i]perylenes. It is also used for preparation of FLAP protein inhibitors as anti-inflammatory agents and aminoisoquinolinones as PARP-2 selective inhibitFormula:C14H11BO2Purity:97%Molecular weight:222.059-Phenanthreneboronic acid
CAS:Formula:C14H11BO2Purity:98%Color and Shape:SolidMolecular weight:222.04699-Phenanthracenylboronic acid
CAS:9-Phenanthracenylboronic acid is a boron compound that is used in organic synthesis, specifically as a coupling partner in the Suzuki coupling reaction. It has been shown to have anti-inflammatory effects and can be used as a model system for human serum. 9-Phenanthracenylboronic acid can be used to prepare polyclonal antibodies with high specificity for fatty acid. This compound has been studied using X-ray crystal structures, which show that it has photophysical properties and can be used as a matrix effect in solid phase microextraction.
Formula:C14H11BO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:222.05 g/mol9-Phenanthreneboronic acid
CAS:Formula:C14H11BO2Purity:95%Color and Shape:SolidMolecular weight:222.05





