CAS 68579-35-1
:1-phenylpyridinium chloride
Description:
1-Phenylpyridinium chloride is a quaternary ammonium compound characterized by its pyridinium ring structure, which is a six-membered aromatic ring containing a nitrogen atom. This compound typically appears as a white to off-white solid and is soluble in water and various organic solvents, making it useful in different chemical applications. It exhibits properties typical of ionic compounds, including high melting points and conductivity in solution. The presence of the phenyl group contributes to its hydrophobic characteristics, influencing its interaction with biological membranes and its potential use in pharmaceutical applications. Additionally, 1-phenylpyridinium chloride can act as a surfactant and is often studied for its antimicrobial properties. Safety data indicates that, like many quaternary ammonium compounds, it should be handled with care due to potential irritant effects on skin and eyes. Overall, its unique structure and properties make it a compound of interest in both industrial and research settings.
Formula:C11H12ClNO
InChI:InChI=1/C11H10N.ClH/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-10H;1H/q+1;/p-1
Synonyms:- Pyridinium, 1-Phenyl-, Chloride (1:1)
- 1-Phenylpyridinium chloride
- Indocyanine Green Impurity 4
- N-PHENYLPYRIDINIUM CHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
