CymitQuimica logo

CAS 685827-70-7

:

1-pyridin-2-ylpiperidine-4-carboxylic acid

Description:
1-Pyridin-2-ylpiperidine-4-carboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring substituted with a pyridine group and a carboxylic acid functional group. This compound typically exhibits properties associated with both heterocyclic amines and carboxylic acids, such as moderate solubility in polar solvents due to the presence of the carboxylic acid group. The pyridine moiety contributes to its potential basicity and ability to participate in hydrogen bonding. It may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure allows for various interactions, which can influence its reactivity and stability under different conditions. Additionally, its specific stereochemistry can affect its pharmacological properties, making it a subject of study in the context of receptor binding and enzyme inhibition. Overall, 1-pyridin-2-ylpiperidine-4-carboxylic acid represents a versatile scaffold for further chemical modifications and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H14N2O2
InChI:InChI=1/C11H14N2O2/c14-11(15)9-4-7-13(8-5-9)10-3-1-2-6-12-10/h1-3,6,9H,4-5,7-8H2,(H,14,15)
InChI key:NUPQTEYBFNCZHX-UHFFFAOYSA-N
SMILES:c1ccnc(c1)N1CCC(CC1)C(=O)O
Synonyms:
  • 1-(Pyridin-2-yl)piperidine-4-carboxylic acid
  • 3,4,5,6-Tetrahydro-2H-[1,2']bipyridinyl-4-carboxylic acid
  • 4-Piperidinecarboxylic acid, 1-(2-pyridinyl)-
Found 5 products.