CymitQuimica logo

CAS 68588-39-6

:

6-chloro-N-ethylpyridazin-3-amine

Description:
6-Chloro-N-ethylpyridazin-3-amine is a chemical compound characterized by its pyridazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a chlorine atom at the 6-position and an ethyl group attached to the nitrogen at the 1-position contributes to its unique properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amine functional group, which can engage in hydrogen bonding. Its structure suggests potential reactivity, particularly in nucleophilic substitution reactions, owing to the electron-withdrawing nature of the chlorine atom. Additionally, the amine group may participate in various chemical transformations, making it a candidate for further derivatization in synthetic chemistry. The compound's biological activity may also be of interest, as derivatives of pyridazine are often explored for pharmaceutical applications. Overall, 6-chloro-N-ethylpyridazin-3-amine is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C6H8ClN3
InChI:InChI=1/C6H8ClN3/c1-2-8-6-4-3-5(7)9-10-6/h3-4H,2H2,1H3,(H,8,10)
InChI key:STAKPHFAQGICDI-UHFFFAOYSA-N
SMILES:CCN=c1ccc(Cl)n[nH]1
Synonyms:
  • 3-Chloro-6-ethylaminopyridazine
  • N-(6-Chloro-pyridazin-3-yl) ethylamine
Found 4 products.