CAS 685892-15-3

2-[(2-Fluorophenyl)thio]ethanol

Description:

2-[(2-Fluorophenyl)thio]ethanol is an organic compound characterized by the presence of a thiol ether functional group and a fluorinated aromatic ring. Its molecular structure features a two-carbon ethyl chain linked to a thiol group (-S-) and a 2-fluorophenyl group, which contributes to its unique chemical properties. The presence of the fluorine atom on the phenyl ring can influence the compound's reactivity, polarity, and overall stability. This compound is typically a colorless to pale yellow liquid and may exhibit moderate solubility in polar solvents due to the hydroxyl group (-OH) present in its structure. Its potential applications may include use in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Safety data should be consulted to understand its toxicity and handling precautions, as compounds containing sulfur and fluorine can pose specific health and environmental risks. Overall, 2-[(2-Fluorophenyl)thio]ethanol represents a versatile compound in organic chemistry with potential utility in various chemical applications.

Formula: C₈H₉FOS

InChI: InChI=1S/C8H9FOS/c9-7-3-1-2-4-8(7)11-6-5-10/h1-4,10H,5-6H2

InChI key: InChIKey=RRDIRFYMPUIMAU-UHFFFAOYSA-N

SMILES: S(CCO)C1=C(F)C=CC=C1

Synonyms:

• 2-[(2-Fluorophenyl)sulfanyl]ethan-1-ol
• 2-[(2-Fluorophenyl)thio]ethanol
• Ethanol, 2-[(2-fluorophenyl)thio]-

2-[(2-Fluorophenyl)thio]ethanol

CAS: 685892-15-3

Formula: C₈H₉FOS

Purity: 98.0%

Color and Shape: Clear

Molecular weight: 172.22

Ref: 10-F019277