CAS 685892-19-7
:1-(5-Chloro-2-methoxy-4-methyl-3-nitrophenyl)ethanone
Description:
1-(5-Chloro-2-methoxy-4-methyl-3-nitrophenyl)ethanone, with the CAS number 685892-19-7, is an organic compound characterized by its complex aromatic structure. This substance features a phenyl ring substituted with a chloro group, a methoxy group, a methyl group, and a nitro group, contributing to its diverse chemical properties. The presence of the ethanone functional group indicates that it is a ketone, which typically exhibits reactivity associated with carbonyl compounds, such as nucleophilic addition. The chloro and nitro substituents can enhance the compound's electrophilicity, making it potentially useful in various chemical reactions, including electrophilic aromatic substitution. Additionally, the methoxy group can influence the compound's solubility and reactivity due to its electron-donating properties. Overall, this compound's unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research and development.
Formula:C10H10ClNO4
InChI:InChI=1S/C10H10ClNO4/c1-5-8(11)4-7(6(2)13)10(16-3)9(5)12(14)15/h4H,1-3H3
InChI key:InChIKey=UTVZRENLZWGEAO-UHFFFAOYSA-N
SMILES:O(C)C1=C(N(=O)=O)C(C)=C(Cl)C=C1C(C)=O
Synonyms:- 1-(5-Chloro-2-methoxy-4-methyl-3-nitrophenyl)ethanone
- 1-(5-Chloro-2-methoxy-4-methyl-3-nitrophenyl)ethan-1-one
- Ethanone, 1-(5-chloro-2-methoxy-4-methyl-3-nitrophenyl)-
- 5-CHLORO-2-METHOXY-4-METHYL-3-NITROACETOPHENONE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
