CAS 68592-15-4
:4-Methoxyhonokiol
Description:
4-Methoxyhonokiol is a naturally occurring compound derived from the bark of the Magnolia tree, specifically from the species Magnolia officinalis. It belongs to the class of compounds known as biphenyls and is characterized by its methoxy group (-OCH3) attached to a biphenyl structure. This compound exhibits a range of biological activities, including anti-inflammatory, antioxidant, and potential neuroprotective effects, making it of interest in pharmacological research. Its molecular structure contributes to its ability to interact with various biological targets, which may lead to therapeutic applications. Additionally, 4-Methoxyhonokiol is soluble in organic solvents, and its stability can be influenced by environmental factors such as temperature and pH. As with many natural products, the extraction and purification processes are crucial for obtaining this compound in a usable form for research and potential medicinal applications. Overall, 4-Methoxyhonokiol represents a promising area of study in the field of natural product chemistry and drug development.
Formula:C19H20O2
InChI:InChI=1S/C19H20O2/c1-4-6-14-8-10-18(20)17(12-14)15-9-11-19(21-3)16(13-15)7-5-2/h4-5,8-13,20H,1-2,6-7H2,3H3
InChI key:InChIKey=OQFHJKZVOALSPV-UHFFFAOYSA-N
SMILES:OC=1C(=CC(CC=C)=CC1)C2=CC(CC=C)=C(OC)C=C2
Synonyms:- (1,1'-Biphenyl)-2-ol, 4'-methoxy-3',5-di-2-propenyl-
- 3,5′-Diallyl-2′-hydroxy-4-methoxybiphenyl
- 4-Methoxyhonokiol
- 4-O-Methyl honokiol
- 4′-Methoxy-3′,5-di-2-propen-1-yl[1,1′-biphenyl]-2-ol
- 4′-O-Methylhonokiol
- NSC 293101
- [1,1'-Biphenyl]-2-Ol, 4'-Methoxy-3',5-Di-2-Propen-1-Yl-
- [1,1′-Biphenyl]-2-ol, 4′-methoxy-3′,5-di-2-propen-1-yl-
- [1,1′-Biphenyl]-2-ol, 4′-methoxy-3′,5-di-2-propenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4'-Methoxy-3',5-di-2-propen-1-yl[1,1'-biphenyl]-2-ol
CAS:Formula:C19H20O2Purity:98%Color and Shape:LiquidMolecular weight:280.36094-O-Methyl honokiol
CAS:4-O-Methyl honokiol (4-O-Methylhonokiol), derived from Magnolia officinalis and Magnolia officinalis, is a PPARγ agonist with antiangiogenic properties.Formula:C19H20O2Purity:99.31%Color and Shape:SolidMolecular weight:280.36Ref: TM-T10153
1mg54.00€5mg114.00€1mL*10mM (DMSO)124.00€10mg177.00€25mg335.00€50mg500.00€100mg718.00€500mg1,485.00€4-o-Methyl honokiol
CAS:4-O-methyl honokiol is a natural compound that has been shown to have anti-inflammatory and antitumor activities. It inhibits the growth of squamous cell carcinoma, human polymorphonuclear leukocytes, and chronic cough in mice. 4-O-Methyl honokiol also inhibits the activity of protein kinase C (PKC) and phosphatidylinositol 3-kinase (PI3K), which are key enzymes in the apoptosis pathway. This compound binds to DNA and alters its structure, making it unable to bind to transcription factors necessary for gene expression. 4-O-Methyl honokiol also decreases the rate constant for p-glycoprotein substrate transport in mitochondria, leading to a decrease in mitochondrial membrane potential.Formula:C19H20O2Purity:Min. 95%Molecular weight:280.4 g/mol




