CAS 686-44-2
:threonylglycine
Description:
Threonylglycine, with the CAS number 686-44-2, is a dipeptide composed of the amino acids threonine and glycine. It is characterized by its structure, which includes an amine group, a carboxylic acid group, and a side chain derived from threonine, contributing to its unique properties. Threonylglycine is typically a white to off-white crystalline powder, soluble in water due to its polar nature, which is influenced by the hydroxyl group present in threonine. This compound is of interest in biochemical research and may have applications in nutrition and pharmaceuticals, particularly in studies related to protein synthesis and metabolism. Its stability can be affected by factors such as pH and temperature, and it may participate in various biochemical reactions, including enzymatic processes. Additionally, threonylglycine can serve as a building block for more complex peptides and proteins, making it relevant in the fields of biochemistry and molecular biology.
Formula:C6H12N2O4
InChI:InChI=1/C6H12N2O4/c1-3(9)5(7)6(12)8-2-4(10)11/h3,5,9H,2,7H2,1H3,(H,8,12)(H,10,11)
SMILES:CC(C(C(=NCC(=O)O)O)N)O
Synonyms:- Glycine, Threonyl-
- Threonyl-Glycine
- Thr-Gly
- H-Thr-Gly-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
L-Threonylglycine
CAS:Controlled ProductFormula:C6H12N2O4Color and Shape:NeatMolecular weight:176.171H-Thr-Gly-OH
CAS:H-Thr-Gly-OH is a synthetic polymerase chain reaction product. It is a mixture of H-Thr and Gly, which are two amino acids that are involved in the replication of DNA. The sequences of these two amino acids have been determined and found to be phylogenetically related to each other. H-Thr-Gly-OH was synthesized by the ethyl esterification of H-Thr with Gly. This reaction product has been shown to have locomotor activity in Drosophila melanogaster and may also possess some other properties that are unknown at this time.Formula:C6H12N2O4Purity:Min. 95%Molecular weight:176.17 g/molH-Thr-Gly-OH
CAS:Bachem ID: 4001319.
Formula:C6H12N2O4Purity:> 99%Color and Shape:White PowderMolecular weight:176.17



