CAS 686279-09-4

Ethyl 4,6-Dichloro-2-methylnicotinate

Description:

Ethyl 4,6-Dichloro-2-methylnicotinate is a chemical compound that belongs to the class of nicotinic acid derivatives. It features a pyridine ring substituted with ethyl, dichloro, and methyl groups, which contribute to its unique properties. The presence of chlorine atoms at the 4 and 6 positions enhances its reactivity and potential biological activity. This compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which is common for many halogenated organic compounds. Ethyl 4,6-Dichloro-2-methylnicotinate may exhibit various pharmacological activities, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, particularly in the context of nicotinic receptors. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity. Overall, this compound represents a valuable entity for research in both synthetic and medicinal chemistry.

Formula: C₉H₉Cl₂NO₂

InChI: InChI=1S/C9H9Cl2NO2/c1-3-14-9(13)8-5(2)12-7(11)4-6(8)10/h4H,3H2,1-2H3

SMILES: CCOC(=O)c1c(C)nc(cc1Cl)Cl

Synonyms:

• 4,6-Dichloro-2-methyl-nicotinic acid ethyl ester

Ethyl 4,6-dichloro-2-methylnicotinate

CAS: 686279-09-4

Formula: C₉H₉Cl₂NO₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 234.0793

Ref: IN-DA0033VE

Ethyl 4,6-dichloro-2-methylnicotinate

CAS: 686279-09-4

Ethyl 4,6-dichloro-2-methylnicotinate

Purity: 98%

Color and Shape: Colourless Liquid

Molecular weight: 234.08g/mol

Ref: 54-OR302196

Ethyl 4,6-dichloro-2-methylnicotinate

CAS: 686279-09-4

Formula: C₉H₉Cl₂NO₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 234.08

Ref: 10-F234269