CymitQuimica logo

CAS 68645-45-4

:

2-[2-(Phenylmethylene)hydrazinyl]-5-sulfobenzoic acid

Description:
2-[2-(Phenylmethylene)hydrazinyl]-5-sulfobenzoic acid, identified by its CAS number 68645-45-4, is an organic compound characterized by its complex structure, which includes a sulfonic acid group and a hydrazine moiety. This compound typically exhibits properties associated with both hydrazine derivatives and aromatic sulfonic acids, such as solubility in polar solvents and potential reactivity due to the presence of the hydrazine functional group. The phenylmethylene group contributes to its aromatic characteristics, which may influence its electronic properties and reactivity. The sulfonic acid group enhances its solubility in water and may impart acidic properties, making it useful in various chemical applications, including as a reagent in organic synthesis or as a potential dye intermediate. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, including condensation and substitution reactions. Overall, this compound's unique structure and functional groups make it of interest in both synthetic chemistry and potential applications in materials science.
Formula:C14H12N2O5S
InChI:InChI=1/C14H12N2O5S/c17-14(18)12-8-11(22(19,20)21)6-7-13(12)16-15-9-10-4-2-1-3-5-10/h1-9,16H,(H,17,18)(H,19,20,21)
InChI key:InChIKey=VVHZWOZTIIKKRH-UHFFFAOYSA-N
SMILES:N(N=CC1=CC=CC=C1)C2=C(C(O)=O)C=C(S(=O)(=O)O)C=C2
Synonyms:
  • 2-(2-Benzylidenehydrazino)-5-sulfobenzoic acid
  • 2-(2-Benzylidenehydrazinyl)-5-sulfobenzoic acid
  • 2-(2-Benzylidenehydrazinyl)-5-sulfobenzoicacid
  • 2-[2-(Phenylmethylene)hydrazinyl]-5-sulfobenzoic acid
  • Benzoic Acid, 2-[2-(Phenylmethylene)Hydrazinyl]-5-Sulfo-
  • Benzoic acid, 2-[(phenylmethylene)hydrazino]-5-sulfo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.