CAS 68654-22-8
:2,3,5,6-Tetramethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione
Description:
2,3,5,6-Tetramethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione, with CAS number 68654-22-8, is a heterocyclic organic compound characterized by its pyrazole ring structure, which is fused with another pyrazole moiety. This compound features four methyl groups at the 2, 3, 5, and 6 positions, contributing to its unique chemical properties and enhancing its lipophilicity. The presence of the 1,7-dione functional groups indicates that it has two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its reactivity and ability to form coordination complexes. Additionally, the presence of multiple methyl groups may influence its biological activity and stability, making it a subject of interest in medicinal chemistry research.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c1-5-7(3)11-8(4)6(2)10(14)12(11)9(5)13/h1-4H3
InChI key:InChIKey=VWKNUUOGGLNRNZ-UHFFFAOYSA-N
SMILES:CC=1N2N(C(=O)C(C)=C2C)C(=O)C1C
Synonyms:- syn-Dimethylbimane
- 2,3,5,6-Tetramethylpyrazolo[1,2-a]pyrazole-1,7-dione
- 1H,7H-Pyrazolo[1,2-a]pyrazole-1,7-dione, 2,3,5,6-tetramethyl-
- 2,3,5,6-Tetramethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione
- 3,4,6,7-Tetramethyl-1,5-diazabicyclo[3.3.0]octa-3,6-diene-2,8-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3,5,6-Tetramethylpyrazolo[1,2-a]pyrazole-1,7-dione
CAS:Controlled ProductApplications 2,3,5,6-Tetramethylpyrazolo[1,2-a]pyrazole-1,7-dione (cas# 68654-22-8) is a compound useful in organic synthesis.
Formula:C10H12N2O2Color and Shape:NeatMolecular weight:192.21
