CAS 68654-22-8

2,3,5,6-Tetramethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione

Description:

2,3,5,6-Tetramethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione, with CAS number 68654-22-8, is a heterocyclic organic compound characterized by its pyrazole ring structure, which is fused with another pyrazole moiety. This compound features four methyl groups at the 2, 3, 5, and 6 positions, contributing to its unique chemical properties and enhancing its lipophilicity. The presence of the 1,7-dione functional groups indicates that it has two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its reactivity and ability to form coordination complexes. Additionally, the presence of multiple methyl groups may influence its biological activity and stability, making it a subject of interest in medicinal chemistry research.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c1-5-7(3)11-8(4)6(2)10(14)12(11)9(5)13/h1-4H3

InChI key: InChIKey=VWKNUUOGGLNRNZ-UHFFFAOYSA-N

SMILES: CC=1N2N(C(=O)C(C)=C2C)C(=O)C1C

Synonyms:

• syn-Dimethylbimane
• 2,3,5,6-Tetramethylpyrazolo[1,2-a]pyrazole-1,7-dione
• 1H,7H-Pyrazolo[1,2-a]pyrazole-1,7-dione, 2,3,5,6-tetramethyl-
• 2,3,5,6-Tetramethyl-1H,7H-pyrazolo[1,2-a]pyrazole-1,7-dione
• 3,4,6,7-Tetramethyl-1,5-diazabicyclo[3.3.0]octa-3,6-diene-2,8-dione

2,3,5,6-Tetramethylpyrazolo[1,2-a]pyrazole-1,7-dione

Controlled Product

CAS: 68654-22-8

Applications 2,3,5,6-Tetramethylpyrazolo[1,2-a]pyrazole-1,7-dione (cas# 68654-22-8) is a compound useful in organic synthesis.

Formula: C₁₀H₁₂N₂O₂

Color and Shape: Neat

Molecular weight: 192.21

Ref: TR-T304650