CAS 6872-57-7

Nitidine

Description:

Nitidine is a chemical compound classified as an alkaloid, primarily derived from the plant species of the Zanthoxylum genus. It is known for its complex structure, which includes a tetracyclic framework. Nitidine exhibits a range of biological activities, including antimicrobial, anti-inflammatory, and potential anticancer properties, making it a subject of interest in pharmacological research. The compound has been studied for its effects on various cellular pathways and its ability to inhibit certain enzymes. In terms of physical properties, nitidine is typically characterized by its solubility in organic solvents and limited solubility in water. Its molecular formula and structure contribute to its reactivity and interaction with biological systems. As with many alkaloids, nitidine's pharmacological effects may vary based on dosage and the specific biological context, highlighting the importance of further research to fully understand its therapeutic potential and safety profile.

Formula: C₂₁H₁₈NO₄

InChI: InChI=1S/C21H18NO4/c1-22-10-13-7-17(23-2)18(24-3)8-15(13)14-5-4-12-6-19-20(26-11-25-19)9-16(12)21(14)22/h4-10H,11H2,1-3H3/q+1

InChI key: InChIKey=KKMPSGJPCCJYRV-UHFFFAOYSA-N

SMILES: C[N+]=1C=2C(C=3C(C1)=CC(OC)=C(OC)C3)=CC=C4C2C=C5C(=C4)OCO5

Synonyms:

• Nitidine
• 2,3-Dimethoxy-12-methyl[1,3]benzodioxolo[5,6-c]phenanthridinium
• [1,3]Benzodioxolo[5,6-c]phenanthridinium, 2,3-dimethoxy-12-methyl-
• Nitidin

[1,3]Dioxolo[4',5':4,5]benzo[1,2-c]phenanthridinium,2,3-dimethoxy-12-methyl-

CAS: 6872-57-7

Formula: C₂₁H₁₈NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 348.3719

Ref: IN-DA0061QL

NITIDINE

CAS: 6872-57-7

NITIDINE

Purity: ≥98%

Molecular weight: 348.37g/mol

Ref: 54-BUP00620

NITIDINE

CAS: 6872-57-7

Nitidine, a benzophenanthridine alkaloid from Zanthoxylum root, has anticancer and other therapeutic properties.

Formula: C₂₁H₁₈NO₄

Purity: 99.84%

Color and Shape: Solid

Molecular weight: 348.37

Ref: TM-T8859