CAS 6872-88-4

Xanthoplanine

Description:

Xanthoplanine, with the CAS number 6872-88-4, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from certain species of plants, particularly those in the genus Xanthorrhoea. This compound is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Xanthoplanine exhibits a range of pharmacological properties, including potential antimicrobial and anti-inflammatory effects, making it of interest in medicinal chemistry. Its solubility characteristics can vary, often being more soluble in organic solvents than in water, which is typical for many alkaloids. Additionally, xanthoplanine may undergo various chemical reactions, such as oxidation or hydrolysis, under specific conditions. The study of xanthoplanine and its derivatives continues to be relevant in the fields of natural product chemistry and drug development, as researchers explore its potential therapeutic applications and mechanisms of action.

Formula: C₂₁H₂₆NO₄

InChI: InChI=1S/C21H25NO4/c1-22(2)7-6-12-10-18(25-4)21(26-5)20-14-11-17(24-3)16(23)9-13(14)8-15(22)19(12)20/h9-11,15H,6-8H2,1-5H3/p+1/t15-/m0/s1

InChI key: InChIKey=FGUCOPALAZXICJ-HNNXBMFYSA-O

SMILES: O(C)C1=C2C=3[C@](CC=4C2=CC(OC)=C(O)C4)([N+](C)(C)CCC3C=C1OC)[H]

Synonyms:

• (6aS)-5,6,6a,7-Tetrahydro-9-hydroxy-1,2,10-trimethoxy-6,6-dimethyl-4H-dibenzo[de,g]quinolinium
• 6aα-Aporphinium, 9-hydroxy-1,2,10-trimethoxy-6-methyl-
• 4H-Dibenzo[de,g]quinolinium, 5,6,6a,7-tetrahydro-9-hydroxy-1,2,10-trimethoxy-6,6-dimethyl-, (S)-
• Xanthoplanine
• 4H-Dibenzo[de,g]quinolinium, 5,6,6a,7-tetrahydro-9-hydroxy-1,2,10-trimethoxy-6,6-dimethyl-, (6aS)-

(+)-Xanthoplanine

CAS: 6872-88-4

Formula: C₂₁H₂₆NO₄

Molecular weight: 356.4354

Ref: IN-DA00FEQW

Xanthoplanine

CAS: 6872-88-4

Xanthoplanine, from Xylopia parviflora roots, blocks alpha7/alpha4beta2 nACh receptors (IC50: 9/5 μM).

Formula: C₂₁H₂₆NO₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 356.44

Ref: TM-T13968

Xanthoplanine

CAS: 6872-88-4

Formula: C₂₁H₂₆NO₄

Purity: 95%~99%

Color and Shape: Brown powder

Molecular weight: 356.441

Ref: BP-SBP01500

(+)-Xanthoplanine

CAS: 6872-88-4

(+)-Xanthoplanine is a natural alkaloid compound, classified as an isoquinoline alkaloid. It is primarily sourced from certain plant species within the Rutaceae and other related families. This compound is characterized by its complex molecular structure featuring multiple aromatic rings, which contribute to its biological activity.

Formula: C₂₁H₂₆NO₄

Purity: Min. 95%

Molecular weight: 356.4 g/mol

Ref: 3D-GAA87288