CAS 6873-15-0
:Arborine
Description:
Arborine, with the CAS number 6873-15-0, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. It is derived from various plant sources and is known for its potential biological activities, including antimicrobial and anti-inflammatory properties. Arborine typically exhibits a complex molecular structure, which contributes to its reactivity and interaction with biological systems. The compound is often studied for its pharmacological potential, although specific applications may vary based on ongoing research. Its solubility, stability, and reactivity can be influenced by environmental conditions such as pH and temperature. As with many alkaloids, safety and toxicity profiles are important considerations in its use, necessitating careful handling and thorough investigation in both laboratory and potential therapeutic contexts. Further studies are essential to fully elucidate its mechanisms of action and potential applications in medicine or agriculture.
Formula:C16H14N2O
InChI:InChI=1S/C16H14N2O/c1-18-14-10-6-5-9-13(14)16(19)17-15(18)11-12-7-3-2-4-8-12/h2-10H,11H2,1H3
InChI key:InChIKey=XVPZRKIQCKKYNE-UHFFFAOYSA-N
SMILES:CN1C=2C(C(=O)N=C1CC3=CC=CC=C3)=CC=CC2
Synonyms:- 1-Methyl-2-(phenylmethyl)-4(1H)-quinazolinone
- 2-Benzyl-1-methylquinazol-4-one
- 2-Benzyl-1-methylquinazolin-4-one
- 4(1H)-Quinazolinone, 2-benzyl-1-methyl-
- 4(1H)-quinazolinone, 1-methyl-2-(phenylmethyl)-
- 6873-15-0
- Arborin
- Arborine
- Glycosin
- Glycosine
- Glycosine (alkaloid)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Benzyl-1-methylquinazolin-4(1H)-one
CAS:Formula:C16H14N2OPurity:98%Color and Shape:SolidMolecular weight:250.2952Arborine
CAS:Arborine (Arborin) is a larval growth inhibitor from glycoslnis pentaphylla.Formula:C16H14N2OPurity:99.45% - 99.46%Color and Shape:SolidMolecular weight:250.3Arborine
CAS:Controlled Product<p>Arborine is a glycol ether that has antimicrobial activity against human pathogens. It is effective in preventing the growth of bacteria and fungi, including Candida albicans and Aspergillus niger, which are responsible for causing bowel diseases. Arborine also has been shown to inhibit the production of colony-stimulating factor by human lymphocytes and stimulate the production of T-helper cells, which can fight autoimmune diseases. This drug binds to DNA in a manner similar to anthranilic acid, inhibiting transcription and translation of RNA. This property makes it an effective treatment for metabolic disorders such as diabetes mellitus type II, rheumatoid arthritis, or Crohn's disease.</p>Formula:C16H14N2OPurity:Min. 95%Molecular weight:250.29 g/mol





