CymitQuimica logo

CAS 6873-44-5

:

4-chloro-N-methylbenzamide

Description:
4-Chloro-N-methylbenzamide is an organic compound characterized by its amide functional group, which consists of a benzene ring substituted with a chlorine atom at the para position and a methyl group attached to the nitrogen of the amide. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The presence of the chlorine atom enhances its reactivity and can influence its biological activity, making it of interest in various chemical and pharmaceutical applications. The compound may exhibit moderate toxicity, and safety precautions should be taken when handling it. Its molecular structure allows for potential interactions in biological systems, which can be explored in medicinal chemistry and drug design. As with many organic compounds, proper storage and handling are essential to maintain stability and prevent degradation.
Formula:C8H8ClNO
InChI:InChI=1/C8H8ClNO/c1-10-8(11)6-2-4-7(9)5-3-6/h2-5H,1H3,(H,10,11)
InChI key:DYDRCANRNSAYJA-UHFFFAOYSA-N
SMILES:CNC(=O)c1ccc(cc1)Cl
Synonyms:
  • benzamide, 4-chloro-N-methyl-
Found 3 products.