CAS 6873-77-4
:5,8-Diethyl-7-hydroxy-6-dodecanone oxime
Description:
5,8-Diethyl-7-hydroxy-6-dodecanone oxime, with the CAS number 6873-77-4, is a chemical compound characterized by its oxime functional group, which is derived from the corresponding ketone. This compound features a long dodecanone chain, contributing to its hydrophobic properties, while the diethyl and hydroxy groups enhance its solubility in organic solvents. The presence of the oxime group suggests potential reactivity, particularly in condensation reactions or as a ligand in coordination chemistry. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceuticals or agrochemicals. Its structure indicates that it may have applications in various fields, including organic synthesis and material science. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines. As with any chemical, safety data sheets should be consulted to ensure proper handling and risk assessment.
Formula:C16H33NO2
InChI:InChI=1S/C16H33NO2/c1-5-9-11-13(7-3)15(17-19)16(18)14(8-4)12-10-6-2/h13-14,16,18-19H,5-12H2,1-4H3
InChI key:InChIKey=SLCANKHLTWZHRV-UHFFFAOYSA-N
SMILES:C(C(CCCC)CC)(C(C(CCCC)CC)O)=NO
Synonyms:- (6Z)-5,8-diethyl-7-hydroxydodecan-6-one oxime
- 5,8-Diethyl-7-Hydroxy-Dodecan-6-One Oxime
- 5,8-Diethyl-7-hydroxy-6-dodecanone oxime
- 5,8-Diethyl-7-hydroxy-6-dodecanone oxime (40-50% in kerosene)
- 5,8-Diethyl-7-hydroxy-6-dodecanonoxime
- 5,8-Diethyl-7-hydroxydodecan-6-oxime
- 5,8-Diethyl-7-hydroxydodecane-6-oxime
- 6-Dodecanone, 5,8-diethyl-7-hydroxy-, oxime
- Lix 63
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
5,8-Diethyl-7-hydroxydodecan-6-one oxime
CAS:Formula:C16H33NO2Color and Shape:SolidMolecular weight:271.43875,8-Diethyl-7-hydroxy-6-dodecanone Oxime
CAS:Controlled Product<p>Applications 5,8-Diethyl-7-hydroxy-6-dodecanone Oxime is a cationic extractant used to separate metals. For example, it can be used in the recovery of indium and gallium from a synthetic each solution of zinc refinery residues.<br>References Wang, L., et al.: Chem. Eng. Commun., 202, 1289 (2015); Nusen, S., et al.: Hydrometallurgy, 160, 137 (2016)<br></p>Formula:C16H33NO2Color and Shape:NeatMolecular weight:271.445,8-Diethyl-7-hydroxy-6-dodecanone oxime
CAS:<p>Please enquire for more information about 5,8-Diethyl-7-hydroxy-6-dodecanone oxime including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C16H33NO2Purity:Min. 95%Molecular weight:271.44 g/mol


