CAS 68733-20-0
:Tetraacetylazidodeoxymannopyranose
Description:
Tetraacetylazidodeoxymannopyranose is a synthetic carbohydrate derivative characterized by the presence of an azido group and multiple acetyl groups attached to a deoxymannopyranose structure. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The presence of the azido group (-N3) makes it a valuable intermediate in organic synthesis, particularly in click chemistry applications, where it can participate in various coupling reactions. The acetyl groups serve to protect hydroxyl functionalities, enhancing the stability and reactivity of the molecule. Tetraacetylazidodeoxymannopyranose is often used in biochemical research, particularly in the study of glycosylation processes and the development of glycosylated compounds for therapeutic applications. Its unique structural features allow for selective reactions, making it a versatile building block in the synthesis of more complex glycosylated molecules. As with many azido compounds, appropriate safety precautions should be taken due to potential reactivity and toxicity.
Formula:C14H19N3O9
InChI:InChI=1/C14H19N3O9/c1-6(18)22-5-10-12(23-7(2)19)13(24-8(3)20)11(16-17-15)14(26-10)25-9(4)21/h10-14H,5H2,1-4H3/t10-,11+,12-,13-,14+/m1/s1
Synonyms:- 1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-alpha-D-mannopyranose
- 1,3,4,6-tetra-O-acetyl-2-azido-2-deoxy-α-D-mannopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-mannopyranose
CAS:Formula:C14H19N3O9Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:373.321,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-mannopyranose
CAS:Formula:C14H19N3O9Purity:98%Molecular weight:373.31541,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-Mannopyranose
CAS:<p>1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-mannopyranose is an analog of N-acetylmannosamine (ManNAc) and a building block.1,2It has been used as a precursor in</p>Formula:C14H19N3O9Color and Shape:SolidMolecular weight:373.321,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-mannopyranose
CAS:1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-mannopyranosePurity:≥95%Molecular weight:373.32g/mol1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-α-D-mannopyranose
CAS:<p>1,3,4,6-Tetra-O-acetyl-2-azido-2-deoxy-a-D-mannopyranose (1,3,4,6-TA) is a stable analog of the glycosidic sugar 2,6-dideoxymannose. This compound has been shown to be a potent inhibitor of the synthesis of Neisseria meningitidis capsular polysaccharides and an effective vaccine adjuvant against Mycobacterium tuberculosis. 1,3,4,6-TA is also a competitive inhibitor for the enzyme mycothiol and other thioglycosidic enzymes that are involved in the biosynthesis of mycolic acids. 1,3,4,6-TA was synthesized from 2-(N'-bromoacetamido)-2'-deoxymannose by reaction with sodium azide in acetone. The structure is bicyclic with two</p>Formula:C14H19N3O9Purity:Min. 95%Color and Shape:White PowderMolecular weight:373.32 g/mol





