CAS 68743-65-7

1-nitroso-5-(pyridin-3-yl)pyrrolidin-2-yl acetate

Description:

1-Nitroso-5-(pyridin-3-yl)pyrrolidin-2-yl acetate is a chemical compound characterized by its unique structure, which includes a nitroso group, a pyrrolidine ring, and a pyridine moiety. The presence of the nitroso functional group suggests potential reactivity, particularly in terms of electrophilic behavior. The pyrrolidine ring contributes to the compound's cyclic structure, which can influence its conformational stability and interactions with biological targets. The acetate group enhances solubility in organic solvents and may participate in esterification reactions. This compound may exhibit biological activity due to the presence of the pyridine ring, which is often associated with pharmacological properties. Additionally, the compound's molecular weight and specific functional groups can affect its physical properties, such as melting point, boiling point, and solubility. Overall, 1-nitroso-5-(pyridin-3-yl)pyrrolidin-2-yl acetate is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications and reactivity.

Formula: C₁₁H₁₃N₃O₃

InChI: InChI=1/C11H13N3O3/c1-8(15)17-11-5-4-10(14(11)13-16)9-3-2-6-12-7-9/h2-3,6-7,10-11H,4-5H2,1H3

SMILES: CC(=O)OC1CCC(c2cccnc2)N1N=O

Synonyms:

• 2-Pyrrolidinol, 1-nitroso-5-(3-pyridinyl)-, acetate (ester)

rac N’-Nitrosonornicotine 5’-Acetate(Mixture of Diastereomers)

Controlled Product

CAS: 68743-65-7

Applications A stable precursor of the active metabolite 5'-hydroxy(+/-)-N'-nitrosonornicotine (NNN-5'-OH).
References Hecht, S., et al.: Chem. Res. Toxicol., 11, 559 (1998), Jalas, J., et al.: Chem. Res. Toxicol., 18, 95 (2005), Lao, Y., et al.: Chem. Res. Toxicol., 20, 246 (2007),

Formula: C₁₁H₁₃N₃O₃

Color and Shape: Neat

Molecular weight: 235.24

Ref: TR-N534995

rac N’-Nitrosonornicotine 5’-Acetate(Mixture of Diastereomers)

CAS: 68743-65-7

Formula: C₁₁H₁₃N₃O₃

Ref: TR-TRC-N534995