CAS 6875-80-5
:H-Glu-Thr-OH
Description:
H-Glu-Thr-OH, also known as L-glutamyl-L-threonine, is a dipeptide composed of the amino acids glutamic acid (Glu) and threonine (Thr). This compound features a peptide bond linking the carboxyl group of glutamic acid to the amino group of threonine, resulting in a structure that exhibits both hydrophilic and hydrophobic characteristics due to the presence of polar and non-polar side chains. The CAS number 6875-80-5 identifies this specific dipeptide in chemical databases. H-Glu-Thr-OH is typically soluble in water, reflecting the polar nature of its constituent amino acids. It may play a role in various biological processes, including protein synthesis and cellular signaling. Additionally, like many peptides, it can be involved in interactions with enzymes and receptors, influencing metabolic pathways. Its stability and reactivity can be affected by environmental conditions such as pH and temperature, which are important considerations in both laboratory and biological contexts.
Formula:C9H16N2O6
InChI:InChI=1S/C9H16N2O6/c1-4(12)7(9(16)17)11-8(15)5(10)2-3-6(13)14/h4-5,7,12H,2-3,10H2,1H3,(H,11,15)(H,13,14)(H,16,17)/t4-,5+,7+/m1/s1
InChI key:InChIKey=JSIQVRIXMINMTA-ZDLURKLDSA-N
SMILES:[C@H](NC([C@H](CCC(O)=O)N)=O)([C@@H](C)O)C(O)=O
Synonyms:- L-Threonine, N-L-α-glutamyl-
- α-L-Glutamyl-L-threonine
- L-Threonine, L-α-glutamyl-
- L-Glutamyl-L-threonine
- L-α-Glutamyl-L-threonine
- H-GLU-THR-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
H-Glu-Thr-OH
CAS:<p>H-Glu-Thr-OH is a molecule that belongs to the group of aminoglycosides. It is a broad spectrum antibiotic that inhibits bacterial protein synthesis by binding to the 30S ribosomal subunit. H-Glu-Thr-OH has been shown to be effective against various bacteria, including those that are resistant to other antibiotics such as penicillin and erythromycin. This drug has also been shown to be effective against cancer cells in vitro. H-Glu-Thr-OH is a potent inhibitor of inflammatory bowel disease, which may be due to its ability to inhibit the production of proinflammatory cytokines such as tumor necrosis factor alpha (TNFα). The drug also has an insulin sensitizing effect in type 2 diabetes mellitus patients, which may be due to its ability to enhance glucose uptake into skeletal muscle cells and adipocytes.</p>Formula:C9H16N2O6Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:248.23 g/molH-Glu-Thr-OH
CAS:<p>H-Glu-Thr-OH (L-α-Glutamyl-L-threonine) is a dipeptide composed of two amino acids—glutamic acid (Glu) and threonine (Thr)—linked by a peptide bond and functions as an agonist of the extracellular calcium-sensing receptor (CaSR).</p>Formula:C9H16N2O6Color and Shape:SolidMolecular weight:248.23


