CAS 68751-05-3
:5-Methyl-thiazole-4-carboxylic acid methyl ester
Description:
5-Methyl-thiazole-4-carboxylic acid methyl ester, with the CAS number 68751-05-3, is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen. This compound features a methyl group at the 5-position and a carboxylic acid moiety that is esterified with methanol, giving it the methyl ester functional group. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the thiazole ring contributes to its potential biological activity, making it of interest in pharmaceutical and agricultural applications. The compound is soluble in organic solvents and may exhibit moderate stability under standard conditions. Its reactivity can be influenced by the functional groups present, allowing for various chemical transformations. As with many thiazole derivatives, it may possess antimicrobial or antifungal properties, although specific biological activities would require further investigation. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C6H7NO2S
InChI:InChI=1/C6H7NO2S/c1-4-5(6(8)9-2)7-3-10-4/h3H,1-2H3
SMILES:Cc1c(C(=O)OC)ncs1
Synonyms:- 4-Thiazolecarboxylic acid, 5-methyl-, methyl ester
- Methyl 5-methyl-1,3-thiazole-4-carboxylate
- Methyl 5-methylthiazole-4-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Methyl-4-thiazolecarboxylic acid methyl ester
CAS:Formula:C6H7NO2SPurity:98%Color and Shape:SolidMolecular weight:157.1903Methyl 5-methylthiazole-4-carboxylate
CAS:Methyl 5-methylthiazole-4-carboxylatePurity:95%Molecular weight:157.19g/molMethyl 5-methylthiazole-4-carboxylate
CAS:Formula:C6H7NO2SPurity:95.0%Color and Shape:LiquidMolecular weight:157.195-Methyl-4-thiazolecarboxylic acid methyl ester
CAS:Controlled ProductPlease enquire for more information about 5-Methyl-4-thiazolecarboxylic acid methyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C6H7NO2SPurity:Min. 95%Molecular weight:157.19 g/mol



