CAS 68751-57-5
:2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol
Description:
2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol, with the CAS number 68751-57-5, is a chemical compound characterized by its complex structure, which includes a dioxolane ring and a bromomethyl group. This compound features a dichlorophenyl substituent, indicating the presence of two chlorine atoms on the phenyl ring, which can significantly influence its reactivity and biological activity. The dioxolane moiety contributes to its potential as a solvent or intermediate in organic synthesis. The presence of the bromomethyl group suggests that it may participate in nucleophilic substitution reactions, making it a useful building block in the synthesis of more complex molecules. Additionally, the hydroxymethyl group at the 4-position of the dioxolane ring may impart some degree of polarity, affecting its solubility in various solvents. Overall, this compound's unique functional groups and structural features make it of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C11H11BrCl2O3
InChI:InChI=1S/C11H11BrCl2O3/c12-6-11(16-5-8(4-15)17-11)9-2-1-7(13)3-10(9)14/h1-3,8,15H,4-6H2
InChI key:InChIKey=KWVAKSFLLNZGBK-UHFFFAOYSA-N
SMILES:C(Br)C1(OC(CO)CO1)C2=C(Cl)C=C(Cl)C=C2
Synonyms:- 1,3-Dioxolane-4-methanol, 2-(bromomethyl)-2-(2,4-dichlorophenyl)-
- [2-(Bromomethyl)-2-(2,4-Dichlorophenyl)-1,3-Dioxolan-4-Yl]Methanol
- 2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
(2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl)methanol
CAS:Formula:C11H11BrCl2O3Color and Shape:LiquidMolecular weight:342.01322-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol (Mixture of diastereomers)
CAS:Applications An intermediate in the preparation of antifungal agents such as Ketoconazole (K186000), Itraconazole (I937500) and Terconazole.
Formula:C11H11BrCl2O3Color and Shape:Colourless To Light YellowMolecular weight:342.01



