CAS 68762-59-4
:2-(acetylamino)-3-(thiophen-2-yl)prop-2-enoic acid
Description:
2-(Acetylamino)-3-(thiophen-2-yl)prop-2-enoic acid, with the CAS number 68762-59-4, is an organic compound characterized by its unique structural features, which include an acetylamino group and a thiophene ring. This compound typically exhibits properties associated with both amino acids and aromatic compounds, such as solubility in polar solvents and potential reactivity due to the presence of functional groups. The thiophene moiety contributes to its aromatic character, potentially influencing its electronic properties and reactivity. The presence of the prop-2-enoic acid structure suggests that it may participate in various chemical reactions, including those typical of α,β-unsaturated carboxylic acids, such as Michael additions or polymerization. Additionally, the acetylamino group may enhance its biological activity, making it of interest in pharmaceutical applications. Overall, this compound's characteristics make it a subject of interest in both synthetic organic chemistry and medicinal chemistry, where its unique functional groups can be leveraged for various applications.
Formula:C9H9NO3S
InChI:InChI=1/C9H9NO3S/c1-6(11)10-8(9(12)13)5-7-3-2-4-14-7/h2-5H,1H3,(H,10,11)(H,12,13)
SMILES:CC(=NC(=Cc1cccs1)C(=O)O)O
Synonyms:- 2-Acetamido-3-(2-thienyl)acrylic acid
- 2-Propenoic Acid, 2-(Acetylamino)-3-(2-Thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Acetylamino)-3-(2-thienyl)-2-propenoic acid
CAS:2-(Acetylamino)-3-(2-thienyl)-2-propenoic acid
Molecular weight:211.24g/mol
