CAS 687635-04-7

1-[3-(1H-Pyrazol-1-yl)phenyl]methanamine

Description:

1-[3-(1H-Pyrazol-1-yl)phenyl]methanamine, with the CAS number 687635-04-7, is an organic compound characterized by its unique structure that includes a phenyl group substituted with a pyrazole moiety and an amine functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine group. The pyrazole ring contributes to its biological activity, making it of interest in medicinal chemistry and drug development. The compound may display various pharmacological properties, including potential anti-inflammatory or anti-cancer activities, depending on its specific interactions within biological systems. Additionally, its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 1-[3-(1H-Pyrazol-1-yl)phenyl]methanamine represents a class of compounds that are valuable in research and development within the fields of chemistry and pharmacology.

Formula: C₁₀H₁₁N₃

InChI: InChI=1/C10H11N3/c11-8-9-3-1-4-10(7-9)13-6-2-5-12-13/h1-7H,8,11H2

SMILES: c1cc(cc(c1)n1cccn1)CN

Synonyms:

• [3-(1H-pyrazol-1-yl)phenyl]methylamine
• Benzenemethanamine, 3-(1H-pyrazol-1-yl)-

(3-(1H-Pyrazol-1-yl)phenyl)methanamine

CAS: 687635-04-7

Formula: C₁₀H₁₁N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 173.2144

Ref: IN-DA006HBT

[3-(1H-Pyrazol-1-yl)phenyl]methylamine

CAS: 687635-04-7

[3-(1H-Pyrazol-1-yl)phenyl]methylamine

Formula: C₁₀H₁₁N₃

Purity: 95%

Color and Shape: brown liquid

Molecular weight: 173.21g/mol

Ref: 54-OR5680

[3-(1H-Pyrazol-1-yl)phenyl]methylamine

CAS: 687635-04-7

Formula: C₁₀H₁₁N₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 173.219

Ref: 10-F065384

[3-(1H-Pyrazol-1-yl)benzyl]amine

CAS: 687635-04-7

3-(1H-Pyrazol-1-yl)benzyl amine is a fine chemical that is used as a versatile building block in the synthesis of many complex compounds, such as pharmaceuticals and agrochemicals. This compound can be used to produce research chemicals, reaction components, and specialty chemicals. 3-(1H-Pyrazol-1-yl)benzyl amine is also a high quality reagent for use in the manufacture of various products.

Formula: C₁₀H₁₁N₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 173.21 g/mol

Ref: 3D-FP129771