CymitQuimica logo

CAS 6877-25-4

:

Cornigerine

Description:
Cornigerine, with the CAS number 6877-25-4, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from certain plant species, particularly those in the family of Apocynaceae. Cornigerine is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. This compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and antimicrobial effects. Its solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its application in research and potential therapeutic uses. Additionally, cornigerine's interactions with biological systems are an area of ongoing study, as researchers explore its mechanisms of action and potential benefits in treating various health conditions. Overall, cornigerine represents a fascinating subject of study within natural product chemistry and pharmacology.
Formula:C21H21NO6
InChI:InChI=1S/C21H21NO6/c1-11(23)22-15-6-4-12-8-18-20(28-10-27-18)21(26-3)19(12)13-5-7-17(25-2)16(24)9-14(13)15/h5,7-9,15H,4,6,10H2,1-3H3,(H,22,23)/t15-/m0/s1
InChI key:InChIKey=DCYAJVOKJAFSES-HNNXBMFYSA-N
SMILES:O(C)C1=C2C=3C([C@@H](NC(C)=O)CCC2=CC4=C1OCO4)=CC(=O)C(OC)=CC3
Synonyms:
  • Cornigerine
  • Heptaleno[1,2-f][1,3]benzodioxole, acetamide deriv.
  • Acetamide, N-(4,6,7,8-tetrahydro-3,13-dimethoxy-4-oxoheptaleno[1,2-f][1,3]benzodioxol-6-yl)-, (S)-
  • Acetamide, N-[(6S)-4,6,7,8-tetrahydro-3,13-dimethoxy-4-oxoheptaleno[1,2-f][1,3]benzodioxol-6-yl]-
  • N-[(6S)-4,6,7,8-Tetrahydro-3,13-dimethoxy-4-oxoheptaleno[1,2-f][1,3]benzodioxol-6-yl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.