CAS 68776-47-6
:1β-Hydroxyalantolactone
Description:
1β-Hydroxyalantolactone, with the CAS number 68776-47-6, is a naturally occurring compound classified as a sesquiterpene lactone. It is derived from plants, particularly those in the Asteraceae family, and is known for its potential biological activities. This compound typically exhibits a white to pale yellow crystalline appearance and is characterized by its hydroxyl and lactone functional groups, which contribute to its reactivity and solubility properties. 1β-Hydroxyalantolactone has garnered interest in pharmacological research due to its reported anti-inflammatory, antimicrobial, and cytotoxic effects. Its structure allows for various interactions with biological targets, making it a subject of study in medicinal chemistry. Additionally, it may play a role in traditional medicine practices, although further research is needed to fully elucidate its therapeutic potential and mechanisms of action. As with many natural products, the extraction and purification processes can influence its yield and purity, which are critical for both research and potential applications.
Formula:C15H20O3
InChI:InChI=1S/C15H20O3/c1-8-4-5-13(16)15(3)7-12-10(6-11(8)15)9(2)14(17)18-12/h6,8,10,12-13,16H,2,4-5,7H2,1,3H3/t8-,10+,12+,13+,15+/m0/s1
InChI key:InChIKey=FRNIMDDQCZHAFA-SCFTVSGOSA-N
SMILES:C[C@]12C(=C[C@]3([C@@](C1)(OC(=O)C3=C)[H])[H])[C@@H](C)CC[C@H]2O
Synonyms:- Naphtho[2,3-b]furan-2(3H)-one, 3a,5,6,7,8,8a,9,9a-octahydro-8-hydroxy-5,8a-dimethyl-3-methylene-, (3aR,5S,8R,8aR,9aR)-
- Naphtho[2,3-b]furan-2(3H)-one, 3a,5,6,7,8,8a,9,9a-octahydro-8-hydroxy-5,8a-dimethyl-3-methylene-, [3aR-(3aα,5β,8β,8aβ,9aα)]-
- 1β-Hydroxyalantolactone
- (3aR,5S,8R,8aR,9aR)-3a,5,6,7,8,8a,9,9a-Octahydro-8-hydroxy-5,8a-dimethyl-3-methylenenaphtho[2,3-b]furan-2(3H)-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1β-Hydroxyalantolactone
CAS:1beta-Hydroxyalantolactone is a small molecular compound isolated from the flower head of the medicinal plant giant British flower, which can inhibit theFormula:C15H20O3Purity:98.09% - 99.85%Color and Shape:SolidMolecular weight:248.321Beta-Hydroxyalantolactone
CAS:Controlled Product1Beta-Hydroxyalantolactone is a sesquiterpene lactone that can be found in plants such as japonica. It has been shown to have antioxidative activities and can inhibit the production of TNF-α, an inflammatory cytokine, in cells. 1Beta-Hydroxyalantolactone has also been used successfully to treat cancer and obesity. This molecule has been shown to decrease body fat mass and serum levels of glucose, insulin, and triglyceride in mice. 1Beta-Hydroxyalantolactone is also useful for treating coughs, inhibiting the enzyme that produces prostaglandin E2, which causes inflammation.Formula:C15H20O3Purity:Min. 95%Molecular weight:248.32 g/mol



