CAS 6879-59-0
:(8alpha,9beta,10xi)-6,8-dimethylergolin-9-yl acetate
Description:
(8alpha,9beta,10xi)-6,8-dimethylergolin-9-yl acetate, with the CAS number 6879-59-0, is a chemical compound belonging to the ergoline family, which is characterized by a tetracyclic structure derived from lysergic acid. This compound features specific stereochemistry, indicated by its alpha and beta designations, which influence its biological activity and interaction with receptors. Ergoline derivatives are known for their diverse pharmacological properties, including effects on the central nervous system. The presence of the acetate group suggests that it may exhibit ester-like reactivity, potentially influencing its solubility and stability. Additionally, the dimethyl groups on the ergoline structure can affect its lipophilicity and receptor binding affinity. While specific biological activities and applications of this compound may not be widely documented, ergoline derivatives are often explored for their potential therapeutic uses, including in the treatment of neurological disorders. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C18H22N2O2
InChI:InChI=1S/C18H22N2O2/c1-10-9-20(3)15-7-12-8-19-14-6-4-5-13(16(12)14)17(15)18(10)22-11(2)21/h4-6,8,10,15,17-19H,7,9H2,1-3H3/t10-,15-,17-,18+/m1/s1
InChI key:InChIKey=GJSSYQDXZLZOLR-ONUGHKICSA-N
SMILES:O(C(C)=O)[C@@H]1[C@@]2(C=3C=4C(C[C@]2(N(C)C[C@H]1C)[H])=CNC4C=CC3)[H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Fumigaclavine A
CAS:<p>Fumigaclavine A, a clavine alkaloid mycotoxin produced by Aspergillus fumigatus, can be isolated from mold-contaminated silage [1].</p>Formula:C18H22N2O2Color and Shape:SolidMolecular weight:298.38

