CAS 68792-52-9
:5-methyltetrahydrofolic acid disodium salt
Description:
5-Methyltetrahydrofolic acid disodium salt, also known as L-methylfolate, is the bioactive form of folate, a B-vitamin essential for various physiological functions. It plays a crucial role in one-carbon metabolism, which is vital for DNA synthesis, repair, and methylation, as well as amino acid metabolism. This compound is characterized by its solubility in water, making it readily absorbable in the human body. The disodium salt form enhances its stability and bioavailability compared to other folate forms. It is often used as a dietary supplement, particularly for individuals with certain genetic polymorphisms that impair the conversion of folic acid to its active form. Additionally, 5-methyltetrahydrofolic acid is involved in the synthesis of neurotransmitters, contributing to mental health and cognitive function. Its safety profile is generally favorable, with low toxicity, although excessive intake may lead to potential side effects. Overall, this compound is significant in nutritional biochemistry and therapeutic applications, particularly in addressing folate deficiency and related health issues.
Formula:C20H23N7Na2O6
InChI:InChI=1/C20H25N7O6.2Na/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);;/q;2*+1/p-2
SMILES:CN1C(CNc2ccc(cc2)C(=O)NC(CCC(=O)O)C(=O)O)CNc2c1c(nc(=N)[nH]2)O.[Na].[Na]
Synonyms:- Disodium 2-[(4-{[(2-Amino-5-Methyl-4-Oxo-1,4,5,6,7,8-Hexahydropteridin-6-Yl)Methyl]Amino}Benzoyl)Amino]Pentanedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Methyltetrahydrofolic acid disodium salt
CAS:Formula:C20H23N7Na2O6Purity:88%Molecular weight:503.41955-Methyltetrahydrofolic acid disodium salt
CAS:5-Methyltetrahydrofolic acid disodium salt is a form of vitamin B9 that is produced by the body from 5,10-methylenetetrahydrofolate. It also can be obtained through the diet in foods such as milk, eggs, and leafy vegetables. This vitamin is necessary for many cellular processes, including amino acid metabolism. 5-Methyltetrahydrofolic acid disodium salt has been shown to have a significant effect on neuron cell growth and health. It has been shown to stimulate the enzyme activities of catecholamine-O-methyltransferase and dopamine beta hydroxylase in vitro. The effects were seen with both acidic and neutral pHs. 5-Methyltetrahydrofolic acid disodium salt has been found to be a selective inhibitor of receptor α (rho) uptake in Caco-2 cells at acidic pHs but not at neutral pHs. In additionFormula:C20H23N7Na2O6Color and Shape:PowderMolecular weight:503.42 g/mol

