CAS 688009-09-8

3',5'-bis-O-[tert-butyl(dimethyl)silyl]-2'-deoxy-2',2'-difluorocytidine

Description:

3',5'-bis-O-[tert-butyl(dimethyl)silyl]-2'-deoxy-2',2'-difluorocytidine is a modified nucleoside analog that features a cytidine base with specific chemical modifications. This compound is characterized by the presence of a deoxyribose sugar, which lacks a hydroxyl group at the 2' position, and two fluorine atoms at the 2' and 2' positions of the cytosine base, enhancing its stability and potential bioactivity. The tert-butyl(dimethyl)silyl groups serve as protective groups that enhance the compound's solubility and stability in various chemical environments. This modification is often employed in the synthesis of oligonucleotides and can influence the compound's interaction with biological systems, potentially affecting its pharmacological properties. The presence of these silyl groups also facilitates the purification and handling of the compound during synthesis. Overall, this nucleoside analog is of interest in medicinal chemistry and molecular biology for its potential applications in drug development and gene therapy.

Formula: C₂₁H₃₉F₂N₃O₄Si₂

InChI: InChI=1/C21H39F2N3O4Si2/c1-19(2,3)31(7,8)28-13-14-16(30-32(9,10)20(4,5)6)21(22,23)17(29-14)26-12-11-15(24)25-18(26)27/h11-12,14,16-17H,13H2,1-10H3,(H2,24,25,27)/t14-,16-,17-/m1/s1

SMILES: CC(C)(C)[Si](C)(C)OC[C@@H]1[C@H](C([C@H](n2ccc(=N)nc2O)O1)(F)F)O[Si](C)(C)C(C)(C)C

4-amino-1-((2R,4R,5R)-4-((tert-butyldimethylsilyl)oxy)-5-(((tert-butyldimethylsilyl)oxy)methyl)-3,3-difluorotetrahydrofuran-2-yl)pyrimidin-2(1H)-one

CAS: 688009-09-8

4-amino-1-((2R,4R,5R)-4-((tert-butyldimethylsilyl)oxy)-5-(((tert-butyldimethylsilyl)oxy)methyl)-3,3-difluorotetrahydrofuran-2-yl)pyrimidin-2(1H)-one

Purity: 97%

Ref: 54-PC1001395

3',5'-Bis-O-tert-butyldimethylsilyl-2'-deoxy-2',2'-difluorocytidine

CAS: 688009-09-8

3',5'-Bis-O-tert-butyldimethylsilyl-2'-deoxy-2',2'-difluorocytidine is a modified nucleoside that is used as an antiviral agent. It is a phosphoramidite or monophosphate, which can be synthesized from 2'-deoxycytidine and N,N-bis(tert-butyldimethylsilyl)acetamide. 3',5'-Bis-O-tert-butyldimethylsilyl-2'-deoxy-2',2'-difluorocytidine inhibits the synthesis of DNA and RNA by inhibiting the enzymes DNA gyrase and RNA polymerase II. This drug has been shown to have anticancer effects in vitro and in vivo.

Purity: Min. 95%

Ref: 3D-NB100509

4-Amino-1-((2R,4R,5R)-4-((tert-butyldimethylsilyl)oxy)-5-(((tert-butyldimethylsilyl)oxy)methyl)-3,3-difluorotetrahydrofuran-2-yl)pyrimidin-2(1H)-one

CAS: 688009-09-8

Purity: 97%

Molecular weight: 491.24

Ref: 10-F567814