
CAS 68807-89-6
:1-Nitroso-L-tryptophan
Description:
1-Nitroso-L-tryptophan is a chemical compound derived from the amino acid L-tryptophan, characterized by the presence of a nitroso group (-NO) attached to the indole ring of the tryptophan structure. This modification can influence its reactivity and biological activity. The compound is typically a yellow to orange solid and is soluble in polar solvents, reflecting the properties of its parent amino acid. It is known to participate in various biochemical reactions, particularly in the context of nitric oxide signaling and potential roles in cellular processes. As a nitroso derivative, it may exhibit unique properties such as the ability to act as a nitrosating agent, which can lead to the formation of nitrosamines, compounds of interest due to their potential carcinogenic effects. The compound's stability, reactivity, and biological implications make it a subject of interest in both organic chemistry and biochemistry, particularly in studies related to protein modification and signaling pathways. Safety precautions should be taken when handling this compound due to its reactive nature.
Formula:C11H11N3O3
InChI:InChI=1S/C11H11N3O3/c12-9(11(15)16)5-7-6-14(13-17)10-4-2-1-3-8(7)10/h1-4,6,9H,5,12H2,(H,15,16)/t9-/m0/s1
InChI key:InChIKey=WBQJTPDOGLYTBE-VIFPVBQESA-N
SMILES:C([C@@H](C(O)=O)N)C=1C=2C(N(N=O)C1)=CC=CC2
Synonyms:- L-Tryptophan, 1-nitroso-
- 1-Nitroso-L-tryptophan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ref: ST-EA-CP-T90013
Discontinued product

