
CAS 68832-40-6
:Azuleno[6,5-b]furan-2(3H)-one, decahydro-5-hydroxy-4a,8-dimethyl-3-methylene-, [3aR-(3aα,4aβ,5α,7aα,8β,9aα)]-
Description:
Azuleno[6,5-b]furan-2(3H)-one, decahydro-5-hydroxy-4a,8-dimethyl-3-methylene-, with the CAS number 68832-40-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates both azulene and furan moieties. This compound features a decahydro framework, indicating a saturated structure with multiple hydrogen atoms, and includes hydroxyl (-OH) and methylene (-CH2-) functional groups, which contribute to its reactivity and potential applications. The stereochemistry of the compound is specified by the [3aR-(3aα,4aβ,5α,7aα,8β,9aα)] notation, indicating specific spatial arrangements of its atoms that can influence its biological activity and interactions. Azuleno derivatives are often noted for their vibrant colors and potential use in dyes, while furan-containing compounds are recognized for their roles in various chemical reactions and as building blocks in organic synthesis. Overall, this compound may exhibit interesting properties that could be explored in fields such as medicinal chemistry, materials science, and organic synthesis.
Formula:C15H22O3
InChI:InChI=1S/C15H22O3/c1-8-6-12-10(9(2)14(17)18-12)7-15(3)11(8)4-5-13(15)16/h8,10-13,16H,2,4-7H2,1,3H3/t8-,10+,11-,12+,13+,15-/m0/s1
InChI key:InChIKey=BOPADYWRUULRBD-VFZWUETDSA-N
SMILES:C[C@@]12[C@]([C@@H](C)C[C@@]3([C@](C1)(C(=C)C(=O)O3)[H])[H])(CC[C@H]2O)[H]
Synonyms:- Azuleno[6,5-b]furan-2(3H)-one, decahydro-5-hydroxy-4a,8-dimethyl-3-methylene-, [3aR-(3aα,4aβ,5α,7aα,8β,9aα)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Dihydroconfertin
CAS:Dihydroconfertin is a natural product that can be used as a reference standard. The CAS number of Dihydroconfertin is 68832-40-6.Formula:C15H22O3Color and Shape:SolidMolecular weight:250.3
