CymitQuimica logo

CAS 68834-46-8

:

Butanoic acid, 3-methyl-2-methylene-, ethyl ester

Description:
Butanoic acid, 3-methyl-2-methylene-, ethyl ester, with the CAS number 68834-46-8, is an organic compound that belongs to the class of esters. It is characterized by its fruity odor, which is typical of many esters, making it potentially useful in flavoring and fragrance applications. The structure of this compound features a butanoic acid backbone with a methyl group and a methylene group, contributing to its unique properties. As an ester, it is generally less polar than its corresponding acid, which can influence its solubility in various solvents. The compound may exhibit moderate volatility and can participate in reactions typical of esters, such as hydrolysis and transesterification. Its chemical stability is generally good under standard conditions, although it may be sensitive to strong acids or bases. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, this compound's characteristics make it of interest in both industrial and research contexts.
Formula:C8H14O2
InChI:InChI=1S/C8H14O2/c1-5-10-8(9)7(4)6(2)3/h6H,4-5H2,1-3H3
InChI key:SLMXQFJPFDWFNW-UHFFFAOYSA-N
SMILES:CCOC(=O)C(=C)C(C)C
Found 5 products.