CAS 68837-59-2
:4-Bromo-2-methylbenzoic acid
Description:
4-Bromo-2-methylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and a methyl group attached to a benzoic acid structure. Its molecular formula is C9H9BrO2, indicating it contains nine carbon atoms, nine hydrogen atoms, one bromine atom, and two oxygen atoms. The compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents, while being less soluble in water. The presence of the bromine substituent can influence its reactivity, making it useful in various chemical syntheses, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in biological systems. Safety data should be consulted for handling, as with many brominated compounds, it may pose environmental and health risks. Overall, 4-Bromo-2-methylbenzoic acid is a valuable compound in organic chemistry with diverse applications.
Formula:C8H7BrO2
InChI:InChI=1S/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=RVCJOGNLYVNRDN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C)C=C(Br)C=C1
Synonyms:- 2-Methyl-4-Bromobenzoic acid
- 4-Bromo-o-toluic acid
- Benzoic acid, 4-bromo-2-methyl-
- NSC 243710
- Rarechem Al Bo 0455
- o-Toluic acid, 4-bromo-
- 4-Bromo-2-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Bromo-2-methylbenzoic acid, 98+%
CAS:A building block which is used in preparation of anthranilic acids possessing antibacterial activity. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa AesaFormula:C8H7BrO2Purity:98+%Color and Shape:White to cream to pale brown or pale pink to pale gray to gray, Crystals or powder or crystalline powder or lumps or granulesMolecular weight:215.054-Bromo-2-methylbenzoic acid
CAS:Formula:C8H7BrO2Purity:97%Color and Shape:SolidMolecular weight:215.0440Ref: IN-DA0033XN
5kgTo inquire10kgTo inquire25kgTo inquire1g21.00€5g25.00€10g26.00€25g49.00€50g69.00€100g92.00€250g158.00€500g206.00€1kg517.00€4-Bromo-2-methylbenzoic acid
CAS:4-Bromo-2-methylbenzoic acidFormula:C8H7BrO2Purity:≥95%Color and Shape: faint brown to light orange powderMolecular weight:215.04g/mol4-Bromo-2-methylbenzoic acid
CAS:Formula:C8H7BrO2Purity:97%Color and Shape:SolidMolecular weight:215.0464-Bromo-2-methylbenzoic acid
CAS:4-Bromo-2-methylbenzoic acid is a nucleophilic compound that can be used for the synthesis of esters, amides and peptides. It is also an intermediate in the synthesis of 4-bromo-2-methylbenzoic acid methyl ester, which can be used as a cardiac marker. The hydroxylamine group on this molecule reacts with electrophiles such as benzoate to form bromoacetic acid derivatives. This reaction is catalyzed by palladium and other metals. The multidimensional nature of this reaction means it can be used for cross-coupling reactions.Formula:C8H7BrO2Purity:Min. 95%Molecular weight:215.04 g/mol4-Bromo-2-methylbenzoic Acid
CAS:Formula:C8H7BrO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:215.05





